3beta-Acetyloxy-olean-12-en-28-oyl piperazine

ID: ALA4093226

PubChem CID: 53493838

Max Phase: Preclinical

Molecular Formula: C36H58N2O3

Molecular Weight: 566.87

Molecule Type: Small molecule

Names and Identifiers

Canonical SMILES:  CC(=O)O[C@H]1CC[C@]2(C)[C@H]3CC=C4[C@@H]5CC(C)(C)CC[C@]5(C(=O)N5CCNCC5)CC[C@@]4(C)[C@]3(C)CC[C@H]2C1(C)C

Standard InChI:  InChI=1S/C36H58N2O3/c1-24(39)41-29-12-13-33(6)27(32(29,4)5)11-14-35(8)28(33)10-9-25-26-23-31(2,3)15-17-36(26,18-16-34(25,35)7)30(40)38-21-19-37-20-22-38/h9,26-29,37H,10-23H2,1-8H3/t26-,27-,28+,29-,33-,34+,35+,36-/m0/s1

Standard InChI Key:  MOKWBZFMZUWRBT-QZUHWTNASA-N

Molfile:  

     RDKit          2D

 44 49  0  0  0  0  0  0  0  0999 V2000
   14.8528   -8.1224    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.6945   -7.2974    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.6945   -8.9516    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.7029   -8.1266    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.9903   -9.3641    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.2695   -7.2974    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.8529   -5.2516    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.4154   -7.7225    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.5529   -8.1391    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   19.1320   -5.6641    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.8528   -8.9475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.5654   -5.6641    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.9820   -6.8849    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.2571   -4.5349    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.1403  -10.0726    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.5653   -9.3600    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.1279   -7.3017    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   18.4196   -6.8974    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.4321   -4.5349    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.7070   -6.4724    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.2695   -9.7725    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   20.5570   -7.3099    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.8446   -7.7266    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.1320   -6.4849    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.1279   -8.1350    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.5695   -7.7017    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.8446   -6.9016    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.2778   -8.1266    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.4070   -8.5475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.1320   -9.3641    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   20.5570   -6.4890    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.9653  -10.0767    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.2778   -8.9516    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.2696   -6.8974    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.9903   -7.7141    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.9820   -8.5391    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   13.4241   -8.9559    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.7166   -9.3648    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.4237   -8.1387    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   19.8293   -8.5455    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.8232   -9.3711    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.5374   -9.7931    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   21.2594   -9.3833    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.2672   -8.5515    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
 10 24  1  0
 20 18  2  0
 27 22  1  1
 33 21  1  6
  7 12  1  0
 11 16  1  0
 11 30  1  1
 28  6  1  1
  4  8  1  0
 34 22  2  0
 13 20  1  0
  3  4  1  0
 14  7  1  0
 27 24  1  0
  7 10  1  0
  1 26  1  0
 24 18  1  0
 31 27  1  0
 35 36  1  6
 35  4  1  0
 23 25  1  0
 33 28  1  0
 26 28  1  0
 19  7  1  0
  8 29  1  6
  4  2  1  1
 18  8  1  0
  5  3  1  0
 28 35  1  0
 27 23  1  0
 13 35  1  0
 11  1  1  0
 12 31  1  0
  9 22  1  0
 25  8  1  0
 16 33  1  0
 15 16  1  0
 24 17  1  1
 33  5  1  0
 32 16  1  0
 30 37  1  0
 37 38  1  0
 37 39  2  0
  9 40  1  0
  9 44  1  0
 40 41  1  0
 41 42  1  0
 42 43  1  0
 43 44  1  0
M  END

Alternative Forms

1. Parent:

   

   ALA4093226

   [(3S,4aR,6aR,6bS,8aS,12aS,14aR,14bR)-4,4,6a,6b,11,11,14b-heptamethyl-8a-(piperazine-1-carbonyl)-1,2,3,4a,5,6,7,8,9,10,12,12a,14,14a-tetradecahydropicen-3-yl] acetate

Molecule Features

Natural Product: No

Oral: No

Chemical Probe: No

Parenteral: No

Molecule Type: Small molecule

Topical: No

First In Class: No

Black Box: No

Chirality: No

Availability: No

Prodrug: No

Calculated Properties

Molecular Weight: 566.87

Molecular Weight (Monoisotopic): 566.4447

AlogP: 7.15

#Rotatable Bonds: 2

Polar Surface Area: 58.64

Molecular Species: NEUTRAL

HBA: 4

HBD: 1

#RO5 Violations: 2

HBA (Lipinski): 5

HBD (Lipinski): 1

#RO5 Violations (Lipinski): 2

CX Acidic pKa: ┄

CX Basic pKa: 7.82

CX LogP: 6.14

CX LogD: 5.58

Aromatic Rings: ┄

Heavy Atoms: 41

QED Weighted: 0.28

Np Likeness Score: 2.36

References

1. Sommerwerk S, Heller L, Kerzig C, Kramell AE, Csuk R..  (2017)  Rhodamine B conjugates of triterpenoic acids are cytotoxic mitocans even at nanomolar concentrations.,  127  [PMID:28033541] [10.1016/j.ejmech.2016.12.040]

2. Brandes B, Hoenke S, Fischer L, Csuk R..  (2020)  Design, synthesis and cytotoxicity of BODIPY FL labelled triterpenoids.,  185  [PMID:31718946] [10.1016/j.ejmech.2019.111858]

Source

Source(1):

• Scientific Literature