N-cyclohexyl-2-(4-(3-methyl-4-nitro-1-phenyl-1H-pyrazol-5-yloxy)phenyl)-1H-benzo[d]imidazole-5-carboxamide

ID: ALA4093249

PubChem CID: 137654925

Max Phase: Preclinical

Molecular Formula: C30H28N6O4

Molecular Weight: 536.59

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Cc1nn(-c2ccccc2)c(Oc2ccc(-c3nc4cc(C(=O)NC5CCCCC5)ccc4[nH]3)cc2)c1[N+](=O)[O-]

Standard InChI:  InChI=1S/C30H28N6O4/c1-19-27(36(38)39)30(35(34-19)23-10-6-3-7-11-23)40-24-15-12-20(13-16-24)28-32-25-17-14-21(18-26(25)33-28)29(37)31-22-8-4-2-5-9-22/h3,6-7,10-18,22H,2,4-5,8-9H2,1H3,(H,31,37)(H,32,33)

Standard InChI Key:  JWKFMWDGISNHSK-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 40 45  0  0  0  0  0  0  0  0999 V2000
   21.3652  -22.4273    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.3641  -23.2469    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.0721  -23.6558    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.0704  -22.0185    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.7790  -22.4237    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.7838  -23.2423    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.5638  -23.4908    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   24.0412  -22.8257    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.5561  -22.1663    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   24.8564  -22.8203    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.2685  -23.5273    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.0849  -23.5228    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.4902  -22.8122    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.0730  -22.1045    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.2580  -22.1125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.3073  -22.8063    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   27.7108  -22.0956    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.5219  -22.0016    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   28.6860  -21.2011    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   27.9753  -20.7976    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.3721  -21.3488    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.0741  -22.6040    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.8248  -23.3799    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.3762  -23.9820    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.1749  -23.8052    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.4193  -23.0209    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.8662  -22.4222    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.5682  -21.1823    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   26.0257  -21.7935    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   26.3101  -20.4070    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   27.8840  -19.9855    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.6574  -22.0189    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.6572  -21.2017    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   19.9498  -22.4277    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   19.2420  -22.0192    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.2448  -21.2016    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.5410  -20.7933    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.8310  -21.1986    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.8292  -22.0167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.5375  -22.4296    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  8  9  2  0
  9  5  1  0
 10 11  2  0
 11 12  1  0
 12 13  2  0
 13 14  1  0
 14 15  2  0
 15 10  1  0
  8 10  1  0
 13 16  1  0
 16 17  1  0
 17 18  1  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 17  2  0
 18 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 26  1  0
 26 27  2  0
 27 22  1  0
 28 29  2  0
 28 30  1  0
 21 28  1  0
 20 31  1  0
  1 32  1  0
 32 33  2  0
 32 34  1  0
 34 35  1  0
 35 36  1  0
 35 40  1  0
 36 37  1  0
 37 38  1  0
 38 39  1  0
 39 40  1  0
M  CHG  2  28   1  30  -1
M  END

Alternative Forms

  1. Parent:

    ALA4093249

    ---

Associated Targets(Human)

CHEK2 Tchem Serine/threonine-protein kinase Chk2 (4015 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 536.59Molecular Weight (Monoisotopic): 536.2172AlogP: 6.49#Rotatable Bonds: 7
Polar Surface Area: 127.97Molecular Species: NEUTRALHBA: 7HBD: 2
#RO5 Violations: 2HBA (Lipinski): 10HBD (Lipinski): 2#RO5 Violations (Lipinski): 2
CX Acidic pKa: 11.06CX Basic pKa: 4.37CX LogP: 5.90CX LogD: 5.90
Aromatic Rings: 5Heavy Atoms: 40QED Weighted: 0.18Np Likeness Score: -1.49

References

1. Galal SA, Abdelsamie AS, Shouman SA, Attia YM, Ali HI, Tabll A, El-Shenawy R, El Abd YS, Ali MM, Mahmoud AE, Abdel-Halim AH, Fyiad AA, Girgis AS, El-Diwani HI..  (2017)  Part I: Design, synthesis and biological evaluation of novel pyrazole-benzimidazole conjugates as checkpoint kinase 2 (Chk2) inhibitors with studying their activities alone and in combination with genotoxic drugs.,  134  [PMID:28433679] [10.1016/j.ejmech.2017.03.090]

Source