4-(4-isopropoxyphenyl)-3-methyl-1-(7H-purin-6-yl)-4,5-dihydro-1H-pyrazolo[3,4-b]pyridin-6(7H)-one

ID: ALA4093273

PubChem CID: 135634945

Max Phase: Preclinical

Molecular Formula: C21H21N7O2

Molecular Weight: 403.45

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Cc1nn(-c2ncnc3nc[nH]c23)c2c1C(c1ccc(OC(C)C)cc1)CC(=O)N2

Standard InChI:  InChI=1S/C21H21N7O2/c1-11(2)30-14-6-4-13(5-7-14)15-8-16(29)26-20-17(15)12(3)27-28(20)21-18-19(23-9-22-18)24-10-25-21/h4-7,9-11,15H,8H2,1-3H3,(H,26,29)(H,22,23,24,25)

Standard InChI Key:  MZGBYYXCWRZACX-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 30 34  0  0  0  0  0  0  0  0999 V2000
   27.0829  -13.6694    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   27.7882  -14.0738    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.4934  -13.6694    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.4934  -12.8522    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.0806  -12.8483    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.7882  -12.4395    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.6180  -11.6402    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.8052  -11.5550    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   26.4732  -12.3017    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   28.1646  -11.0327    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.7882  -14.8910    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   29.1987  -12.4477    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.9055  -12.8601    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.6139  -12.4543    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.6167  -11.6362    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.9053  -11.2257    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.1998  -11.6339    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.6785  -12.4729    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.0798  -12.8076    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   24.6260  -13.4167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.4285  -13.2495    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   24.3361  -12.0313    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.1301  -11.8619    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.2144  -11.0545    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   24.4724  -10.7248    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.9298  -11.3285    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   31.3251  -11.2287    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   32.0322  -11.6385    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.7405  -11.2310    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.0309  -12.4557    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  5  1  1  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  4  6  1  0
  5  6  2  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9  5  1  0
  7 10  1  0
  2 11  2  0
 12 13  2  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17 12  1  0
  4 12  1  0
 18 23  1  0
 18 21  2  0
 22 19  1  0
 19 20  2  0
 20 21  1  0
  9 18  1  0
 22 23  2  0
 23 24  1  0
 24 25  1  0
 25 26  2  0
 26 22  1  0
 15 27  1  0
 27 28  1  0
 28 29  1  0
 28 30  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4093273

    ---

Associated Targets(Human)

GPR39 Tchem G-protein coupled receptor 39 (216 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Liver (3974 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

Gpr39 G-protein coupled receptor 39 (34 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 403.45Molecular Weight (Monoisotopic): 403.1757AlogP: 3.11#Rotatable Bonds: 4
Polar Surface Area: 110.61Molecular Species: NEUTRALHBA: 7HBD: 2
#RO5 Violations: HBA (Lipinski): 9HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 9.17CX Basic pKa: 2.13CX LogP: 2.14CX LogD: 2.14
Aromatic Rings: 4Heavy Atoms: 30QED Weighted: 0.54Np Likeness Score: -1.14

References

1. Frimurer TM, Mende F, Graae AS, Engelstoft MS, Egerod KL, Nygaard R, Gerlach LO, Hansen JB, Schwartz TW, Holst B..  (2017)  Model-Based Discovery of Synthetic Agonists for the Zn2+-Sensing G-Protein-Coupled Receptor 39 (GPR39) Reveals Novel Biological Functions.,  60  (3): [PMID:28045522] [10.1021/acs.jmedchem.6b00648]

Source