Dehydrolupinifolinol

ID: ALA4093304

PubChem CID: 137653742

Max Phase: Preclinical

Molecular Formula: C25H24O6

Molecular Weight: 420.46

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CC(C)=CCc1c2c(c(O)c3c(=O)c(O)c(-c4ccc(O)cc4)oc13)OC(C)(C)C=C2

Standard InChI:  InChI=1S/C25H24O6/c1-13(2)5-10-16-17-11-12-25(3,4)31-24(17)20(28)18-19(27)21(29)22(30-23(16)18)14-6-8-15(26)9-7-14/h5-9,11-12,26,28-29H,10H2,1-4H3

Standard InChI Key:  PDXSTCCVOJNCGO-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 31 34  0  0  0  0  0  0  0  0999 V2000
   13.9005   -5.6873    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.3132   -4.9816    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.4957   -4.9770    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.4344   -5.3846    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.4326   -3.7472    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.1412   -4.1525    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.1400   -4.9731    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.8462   -5.3822    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.5581   -4.9751    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.5593   -4.1545    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.8485   -3.7409    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   19.2661   -3.7505    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.9731   -4.1626    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.6813   -3.7564    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.6837   -2.9383    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.9721   -2.5281    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.2668   -2.9367    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.8439   -6.1994    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   21.3919   -2.5305    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.4286   -2.9300    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.7189   -2.5249    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.7149   -1.7077    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.0052   -1.3026    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.4206   -1.2957    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.7280   -4.9781    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.7259   -4.1605    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.0207   -3.7558    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.3131   -4.1642    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.0249   -5.3910    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   19.2647   -5.3857    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.4367   -6.2018    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  1  0
 25  4  1  0
  4  7  2  0
  6  5  2  0
  5 26  1  0
  6  7  1  0
  6 11  1  0
  7  8  1  0
  8  9  1  0
  9 10  2  0
 10 11  1  0
 12 13  2  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17 12  1  0
 10 12  1  0
  8 18  2  0
 15 19  1  0
  5 20  1  0
 20 21  1  0
 21 22  2  0
 22 23  1  0
 22 24  1  0
 25 26  2  0
 25 29  1  0
 26 27  1  0
 27 28  2  0
 28  2  1  0
  2 29  1  0
  9 30  1  0
  4 31  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4093304

    ---

Associated Targets(non-human)

Slc2a4 Solute carrier family 2, facilitated glucose transporter member 4 (143 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 420.46Molecular Weight (Monoisotopic): 420.1573AlogP: 5.27#Rotatable Bonds: 3
Polar Surface Area: 100.13Molecular Species: NEUTRALHBA: 6HBD: 3
#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): 3#RO5 Violations (Lipinski): 1
CX Acidic pKa: 7.56CX Basic pKa: CX LogP: 5.39CX LogD: 5.15
Aromatic Rings: 3Heavy Atoms: 31QED Weighted: 0.50Np Likeness Score: 2.46

References

1. Yang X, Deng S, Huang M, Wang J, Chen L, Xiong M, Yang J, Zheng S, Ma X, Zhao P, Feng Y..  (2017)  Chemical constituents from Sophora tonkinensis and their glucose transporter 4 translocation activities.,  27  (6): [PMID:28236591] [10.1016/j.bmcl.2017.01.078]

Source