6'(R)-9-(5',6',7',8'-Deoxy-6'-amine-8'-cyclohexyl-beta-D-octafuranoside-1')adenine

ID: ALA4093389

PubChem CID: 137653502

Max Phase: Preclinical

Molecular Formula: C19H30N6O3

Molecular Weight: 390.49

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Nc1ncnc2c1ncn2[C@@H]1O[C@H](C[C@H](N)CCC2CCCCC2)[C@@H](O)[C@H]1O

Standard InChI:  InChI=1S/C19H30N6O3/c20-12(7-6-11-4-2-1-3-5-11)8-13-15(26)16(27)19(28-13)25-10-24-14-17(21)22-9-23-18(14)25/h9-13,15-16,19,26-27H,1-8,20H2,(H2,21,22,23)/t12-,13-,15-,16-,19-/m1/s1

Standard InChI Key:  WVZVRJWAWUGTBW-BYMDKACISA-N

Molfile:  

     RDKit          2D

 28 31  0  0  0  0  0  0  0  0999 V2000
    9.3825   -9.4388    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.8972  -11.1959    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.1221  -11.2460    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.9452   -9.2929    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.6244   -9.7530    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3934  -10.5428    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5809  -10.5684    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3055   -9.7971    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5140   -9.5684    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9242  -10.1426    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1316   -9.9165    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1262  -10.9346    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.3931   -8.5716    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.5749   -8.6363    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.7073   -9.3298    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.0819   -9.8601    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.2291  -10.6649    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.0012  -10.9405    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.6264  -10.4051    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.4760   -9.6023    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.0970   -9.0710    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.5445  -10.4850    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7587  -10.2608    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5604   -9.4676    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7785   -9.2425    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1883   -9.8082    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3854  -10.6022    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1727  -10.8306    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  8  4  1  0
  8  7  1  0
  4  5  1  0
  7  6  1  0
  5  6  1  0
  8  9  1  1
  5  1  1  1
  6  2  1  6
  7  3  1  6
  9 10  1  0
 10 11  1  0
 10 12  1  6
  1 16  1  0
 15 13  1  0
 13 14  2  0
 14  1  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 15  1  0
 20 21  1  0
 11 22  1  0
 22 23  1  0
 23 24  1  0
 23 28  1  0
 24 25  1  0
 25 26  1  0
 26 27  1  0
 27 28  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4093389

    ---

Associated Targets(Human)

EHMT1 Tchem Histone-lysine N-methyltransferase, H3 lysine-9 specific 5 (407 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
EHMT2 Tchem Histone-lysine N-methyltransferase, H3 lysine-9 specific 3 (93046 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 390.49Molecular Weight (Monoisotopic): 390.2379AlogP: 1.11#Rotatable Bonds: 6
Polar Surface Area: 145.33Molecular Species: BASEHBA: 9HBD: 4
#RO5 Violations: HBA (Lipinski): 9HBD (Lipinski): 6#RO5 Violations (Lipinski): 1
CX Acidic pKa: 12.48CX Basic pKa: 10.07CX LogP: 0.85CX LogD: -1.67
Aromatic Rings: 2Heavy Atoms: 28QED Weighted: 0.57Np Likeness Score: 1.00

References

1. Liu Q, Cai X, Yang D, Chen Y, Wang Y, Shao L, Wang MW..  (2017)  Cycloalkane analogues of sinefungin as EHMT1/2 inhibitors.,  25  (17): [PMID:28739157] [10.1016/j.bmc.2017.06.032]

Source