(Z)-3-(4-(2-benzylpiperidin-1-yl)-4-oxobut-2-enamido)benzamide

ID: ALA4093441

PubChem CID: 137655632

Max Phase: Preclinical

Molecular Formula: C23H25N3O3

Molecular Weight: 391.47

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  NC(=O)c1cccc(NC(=O)/C=C\C(=O)N2CCCCC2Cc2ccccc2)c1

Standard InChI:  InChI=1S/C23H25N3O3/c24-23(29)18-9-6-10-19(16-18)25-21(27)12-13-22(28)26-14-5-4-11-20(26)15-17-7-2-1-3-8-17/h1-3,6-10,12-13,16,20H,4-5,11,14-15H2,(H2,24,29)(H,25,27)/b13-12-

Standard InChI Key:  PYVZAYARZDPDGX-SEYXRHQNSA-N

Molfile:  

     RDKit          2D

 29 31  0  0  0  0  0  0  0  0999 V2000
    8.6080   -2.4185    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.6068   -3.2381    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3149   -3.6470    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.0245   -3.2376    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.0217   -2.4149    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3131   -2.0097    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.7279   -2.0037    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.4371   -2.4096    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.7248   -1.1865    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.3147   -4.4642    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.6069   -4.8726    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.6067   -5.6898    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3143   -6.0986    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.0221   -5.6902    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.7297   -6.0989    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.0223   -4.8730    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.8993   -4.4639    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.7242   -6.9138    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.4278   -7.3224    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1380   -6.9175    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1401   -6.0994    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.4321   -5.6862    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.4308   -4.8690    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1379   -4.4593    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.8443   -4.8686    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.5509   -4.4596    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.5501   -3.6415    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.8368   -3.2342    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1331   -3.6455    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  5  7  1  0
  7  8  1  0
  7  9  2  0
  3 10  1  0
 10 11  1  0
 11 12  1  0
 12 13  2  0
 13 14  1  0
 14 15  1  0
 14 16  2  0
 11 17  2  0
 15 18  1  0
 15 22  1  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 21 22  1  0
 22 23  1  0
 23 24  1  0
 24 25  2  0
 25 26  1  0
 26 27  2  0
 27 28  1  0
 28 29  2  0
 29 24  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4093441

    ---

Associated Targets(Human)

PARP14 Tchem Poly [ADP-ribose] polymerase 14 (380 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 391.47Molecular Weight (Monoisotopic): 391.1896AlogP: 2.90#Rotatable Bonds: 6
Polar Surface Area: 92.50Molecular Species: NEUTRALHBA: 3HBD: 2
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: 13.85CX Basic pKa: CX LogP: 2.81CX LogD: 2.81
Aromatic Rings: 2Heavy Atoms: 29QED Weighted: 0.74Np Likeness Score: -1.00

References

1. Upton K, Meyers M, Thorsell AG, Karlberg T, Holechek J, Lease R, Schey G, Wolf E, Lucente A, Schüler H, Ferraris D..  (2017)  Design and synthesis of potent inhibitors of the mono(ADP-ribosyl)transferase, PARP14.,  27  (13): [PMID:28495083] [10.1016/j.bmcl.2017.04.089]

Source