The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Deltorphin II ID: ALA4093770
PubChem CID: 137654730
Max Phase: Preclinical
Molecular Formula: C29H45N7O8
Molecular Weight: 619.72
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CC(C)[C@H](NC(=O)[C@H](CCC(=O)O)NC(=O)[C@H](Cc1ccccc1)NC(=O)[C@H](C)N)C(=O)N[C@H](C(=O)NCC(N)=O)C(C)C
Standard InChI: InChI=1S/C29H45N7O8/c1-15(2)23(28(43)32-14-21(31)37)36-29(44)24(16(3)4)35-26(41)19(11-12-22(38)39)33-27(42)20(34-25(40)17(5)30)13-18-9-7-6-8-10-18/h6-10,15-17,19-20,23-24H,11-14,30H2,1-5H3,(H2,31,37)(H,32,43)(H,33,42)(H,34,40)(H,35,41)(H,36,44)(H,38,39)/t17-,19-,20-,23-,24-/m0/s1
Standard InChI Key: QVXUVHIZQNYJCY-DMDPWHOSSA-N
Molfile:
RDKit 2D
44 44 0 0 0 0 0 0 0 0999 V2000
22.7572 -16.3923 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
23.4704 -15.9796 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.1795 -17.2095 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
23.4704 -15.1624 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.1795 -16.3923 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.8886 -15.9796 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
25.5977 -16.3923 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.3109 -15.1624 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
26.3109 -15.9796 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.5977 -17.2095 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.3109 -18.4404 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.3109 -17.6222 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.0173 -17.2111 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.7236 -17.6222 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.7236 -18.4404 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.0173 -18.8475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.0200 -16.3923 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
27.7291 -15.9796 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.4381 -17.2095 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
28.4381 -16.3923 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.7291 -15.1624 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.4381 -14.7497 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.4381 -13.9325 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.1472 -13.5198 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
27.7291 -13.5198 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
29.1472 -15.9796 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
29.8605 -16.3923 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.5695 -15.1624 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
30.5695 -15.9796 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.8605 -17.2095 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.5695 -17.6222 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.1472 -17.6222 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.2786 -16.3923 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
31.9877 -15.9796 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.6968 -17.2095 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
32.6968 -16.3923 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.9877 -15.1624 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.6968 -14.7497 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.2786 -14.7497 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.4100 -15.9796 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
34.1191 -16.3923 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.8282 -15.1624 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
34.8282 -15.9796 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.5373 -16.3923 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5 6 1 0
9 17 1 0
20 26 1 0
29 33 1 0
36 40 1 0
43 44 1 0
1 2 1 0
2 5 1 0
5 3 2 0
2 4 1 1
6 7 1 0
7 9 1 0
9 8 2 0
7 10 1 6
10 12 1 0
11 12 2 0
12 13 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 11 1 0
17 18 1 0
18 20 1 0
20 19 2 0
18 21 1 1
21 22 1 0
22 23 1 0
23 24 2 0
23 25 1 0
26 27 1 0
27 29 1 0
29 28 2 0
27 30 1 6
30 31 1 0
30 32 1 0
33 34 1 0
34 36 1 0
36 35 2 0
34 37 1 1
37 38 1 0
37 39 1 0
40 41 1 0
41 43 1 0
43 42 2 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 619.72Molecular Weight (Monoisotopic): 619.3330AlogP: -1.71#Rotatable Bonds: 18Polar Surface Area: 251.91Molecular Species: ACIDHBA: 8HBD: 8#RO5 Violations: 2HBA (Lipinski): 15HBD (Lipinski): 10#RO5 Violations (Lipinski): 3CX Acidic pKa: 4.07CX Basic pKa: 8.09CX LogP: -3.82CX LogD: -3.89Aromatic Rings: 1Heavy Atoms: 44QED Weighted: 0.09Np Likeness Score: -0.13
References 1. Kutsumura N, Koyama Y, Nagumo Y, Nakajima R, Miyata Y, Yamamoto N, Saitoh T, Yoshida N, Iwata S, Nagase H.. (2017) Antitrichomonal activity of δ opioid receptor antagonists, 7-benzylidenenaltrexone derivatives., 25 (16): [PMID:28662966 ] [10.1016/j.bmc.2017.06.026 ]