(1S,5S,9R)-(+)-5-(3-hydroxyphenyl)-2-(4-nitrophenethyl)-2-azabicyclo[3.3.1]nonan-9-ol oxalate

ID: ALA4093929

PubChem CID: 137654005

Max Phase: Preclinical

Molecular Formula: C24H28N2O8

Molecular Weight: 382.46

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  O=C(O)C(=O)O.O=[N+]([O-])c1ccc(CCN2CC[C@]3(c4cccc(O)c4)CCC[C@H]2[C@@H]3O)cc1

Standard InChI:  InChI=1S/C22H26N2O4.C2H2O4/c25-19-4-1-3-17(15-19)22-11-2-5-20(21(22)26)23(14-12-22)13-10-16-6-8-18(9-7-16)24(27)28;3-1(4)2(5)6/h1,3-4,6-9,15,20-21,25-26H,2,5,10-14H2;(H,3,4)(H,5,6)/t20-,21-,22-;/m0./s1

Standard InChI Key:  HHZWUDAEAJEIIA-SGIIKHNDSA-N

Molfile:  

     RDKit          2D

 35 37  0  0  0  0  0  0  0  0999 V2000
   24.1501  -23.6766    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.8584  -23.2677    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.5666  -23.6766    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   24.8584  -22.4499    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   23.4419  -23.2677    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   24.1501  -24.4945    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   19.0114  -22.5503    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.0114  -23.3784    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.7308  -23.7874    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.4405  -23.3784    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.4405  -22.5503    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.7308  -22.1340    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.3030  -22.1413    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.3002  -21.3131    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.5834  -20.9059    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.8654  -21.3196    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.8739  -22.1488    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.5922  -22.5536    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.5826  -20.0779    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   19.7308  -21.3061    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   19.7355  -22.4580    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.0179  -23.1113    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.5776  -22.2095    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   22.2363  -21.7074    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.9998  -22.0199    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.6586  -21.5222    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.4481  -21.7223    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   24.4162  -21.8468    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.0746  -21.3498    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.9732  -20.5295    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.2077  -20.2087    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.5526  -20.7077    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.6665  -20.0047    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   25.5584  -19.1441    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   26.4659  -20.3415    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  2  4  2  0
  1  5  1  0
  1  6  2  0
  7  8  1  0
  7 12  1  0
  8  9  1  0
  9 10  1  0
 10 11  1  0
 11 12  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 13  1  0
  7 13  1  1
 15 19  1  0
 12 20  1  1
  7 21  1  0
 21 22  1  0
 11 23  1  0
 22 23  1  0
 23 24  1  0
 24 25  1  0
 25 26  1  0
 11 27  1  6
 26 28  2  0
 28 29  1  0
 29 30  2  0
 30 31  1  0
 31 32  2  0
 32 26  1  0
 33 34  2  0
 33 35  1  0
 30 33  1  0
M  CHG  2  33   1  35  -1
M  END

Associated Targets(Human)

OPRK1 Tclin Kappa opioid receptor (16155 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

Oprd1 Delta opioid receptor (3911 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Oprm1 Mu opioid receptor (6060 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Oprk1 Kappa opioid receptor (774 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 382.46Molecular Weight (Monoisotopic): 382.1893AlogP: 3.40#Rotatable Bonds: 5
Polar Surface Area: 86.84Molecular Species: BASEHBA: 5HBD: 2
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 10.06CX Basic pKa: 9.16CX LogP: 3.59CX LogD: 2.13
Aromatic Rings: 2Heavy Atoms: 28QED Weighted: 0.61Np Likeness Score: 0.27

References

1. Truong PM, Hassan SA, Lee YS, Kopajtic TA, Katz JL, Chadderdon AM, Traynor JR, Deschamps JR, Jacobson AE, Rice KC..  (2017)  Modulation of opioid receptor affinity and efficacy via N-substitution of 9β-hydroxy-5-(3-hydroxyphenyl)morphan: Synthesis and computer simulation study.,  25  (8): [PMID:28314512] [10.1016/j.bmc.2017.02.064]

Source