4-Methyl-2-oxo-2H-chromene-7,8-diyl bis(4-chlorobenzenesulfonate)

ID: ALA4094013

PubChem CID: 137653769

Max Phase: Preclinical

Molecular Formula: C22H14Cl2O8S2

Molecular Weight: 541.39

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Cc1cc(=O)oc2c(OS(=O)(=O)c3ccc(Cl)cc3)c(OS(=O)(=O)c3ccc(Cl)cc3)ccc12

Standard InChI:  InChI=1S/C22H14Cl2O8S2/c1-13-12-20(25)30-21-18(13)10-11-19(31-33(26,27)16-6-2-14(23)3-7-16)22(21)32-34(28,29)17-8-4-15(24)5-9-17/h2-12H,1H3

Standard InChI Key:  DUHKPKLWHGIILX-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 34 37  0  0  0  0  0  0  0  0999 V2000
   16.2984   -3.5948    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   17.1156   -3.5989    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   16.7106   -2.8892    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.2873   -1.2547    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.7000   -1.9646    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   16.1084   -1.2522    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   17.1183   -1.1473    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.1172   -1.9669    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.8252   -2.3758    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.8234   -0.7385    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.5321   -1.1437    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.5354   -1.9644    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.2439   -2.3695    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   19.9535   -1.9586    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.9501   -1.1379    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.2371   -0.7282    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.2327    0.0927    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.6623   -2.3652    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.4092   -2.3749    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.9937   -2.3738    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.2870   -1.9646    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.5812   -2.3731    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.5820   -3.1902    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.2945   -3.5971    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.9974   -3.1862    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.8258   -3.1930    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   17.1189   -4.4193    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.4123   -4.8257    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.4125   -5.6421    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.1210   -6.0511    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.8308   -5.6376    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.8271   -4.8225    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.8755   -3.6009    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   17.1226   -6.8683    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  2  0
  5  4  2  0
  6  5  2  0
  7  8  2  0
  8  9  1  0
  9 12  2  0
 11 10  2  0
 10  7  1  0
 11 12  1  0
 11 16  1  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 15 16  2  0
 16 17  1  0
 14 18  2  0
  8 19  1  0
 19  5  1  0
  5 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 20  1  0
  9 26  1  0
 26  2  1  0
  2 27  1  0
 27 28  2  0
 28 29  1  0
 29 30  2  0
 30 31  1  0
 31 32  2  0
 32 27  1  0
 23 33  1  0
 30 34  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4094013

    ---

Associated Targets(Human)

ALPL Tchem Alkaline phosphatase, tissue-nonspecific isozyme (1551 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
ALPI Tchem Intestinal alkaline phosphatase (724 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 541.39Molecular Weight (Monoisotopic): 539.9507AlogP: 4.94#Rotatable Bonds: 6
Polar Surface Area: 116.95Molecular Species: NEUTRALHBA: 8HBD:
#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): #RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: CX LogP: 5.72CX LogD: 5.72
Aromatic Rings: 4Heavy Atoms: 34QED Weighted: 0.25Np Likeness Score: -0.31

References

1. Salar U, Khan KM, Iqbal J, Ejaz SA, Hameed A, Al-Rashida M, Perveen S, Tahir MN..  (2017)  Coumarin sulfonates: New alkaline phosphatase inhibitors; in vitro and in silico studies.,  131  [PMID:28288318] [10.1016/j.ejmech.2017.03.003]

Source