The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(propylaminosulfonyl)-4-podophyllotoxin carbamate ID: ALA4094050
PubChem CID: 137655184
Max Phase: Preclinical
Molecular Formula: C26H30N2O11S
Molecular Weight: 578.60
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCCNS(=O)(=O)NC(=O)O[C@H]1c2cc3c(cc2[C@@H](c2cc(OC)c(OC)c(OC)c2)[C@H]2C(=O)OC[C@@H]21)OCO3
Standard InChI: InChI=1S/C26H30N2O11S/c1-5-6-27-40(31,32)28-26(30)39-23-15-10-18-17(37-12-38-18)9-14(15)21(22-16(23)11-36-25(22)29)13-7-19(33-2)24(35-4)20(8-13)34-3/h7-10,16,21-23,27H,5-6,11-12H2,1-4H3,(H,28,30)/t16-,21+,22-,23-/m0/s1
Standard InChI Key: YBFCEVSIUJAMTP-YYLLSARXSA-N
Molfile:
RDKit 2D
42 46 0 0 0 0 0 0 0 0999 V2000
7.8711 -1.4803 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.2853 -2.1875 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
8.6930 -1.4765 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.7512 -5.0558 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7485 -3.4193 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4579 -3.8264 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4561 -4.6435 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1619 -5.0521 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1654 -3.4139 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0427 -4.6472 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0445 -3.8295 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2634 -3.5716 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.7831 -4.2376 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2646 -4.9015 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.8738 -3.8294 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8750 -4.6471 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6531 -4.8967 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1326 -4.2364 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.6511 -3.5736 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1567 -5.8669 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4490 -6.2717 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4458 -7.0865 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1533 -7.4980 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8621 -7.0898 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8600 -6.2729 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1654 -2.5979 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.8693 -2.1900 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8693 -1.3740 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.5773 -2.5980 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.9892 -2.5980 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.9044 -5.6724 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.1523 -8.3140 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.4438 -8.7211 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5710 -7.4963 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.5727 -8.3123 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7362 -7.4958 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.0339 -7.0849 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8707 -3.0122 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
6.9048 -5.4636 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
9.6987 -2.1925 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4046 -2.6042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1141 -2.1987 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
10 4 1 0
4 7 2 0
6 5 2 0
5 11 1 0
6 7 1 0
6 9 1 0
7 8 1 0
8 16 1 0
15 9 1 0
10 11 2 0
11 12 1 0
12 13 1 0
13 14 1 0
14 10 1 0
15 16 1 0
16 17 1 0
17 18 1 0
18 19 1 0
15 19 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 20 1 0
8 20 1 6
9 26 1 6
26 27 1 0
27 28 2 0
27 29 1 0
29 2 1 0
2 30 1 0
17 31 2 0
23 32 1 0
32 33 1 0
24 34 1 0
34 35 1 0
22 36 1 0
36 37 1 0
15 38 1 6
16 39 1 1
30 40 1 0
40 41 1 0
41 42 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 578.60Molecular Weight (Monoisotopic): 578.1570AlogP: 2.39#Rotatable Bonds: 9Polar Surface Area: 156.95Molecular Species: ACIDHBA: 11HBD: 2#RO5 Violations: 2HBA (Lipinski): 13HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: 2.84CX Basic pKa: ┄CX LogP: 1.86CX LogD: 0.92Aromatic Rings: 2Heavy Atoms: 40QED Weighted: 0.42Np Likeness Score: 0.78
References 1. Xu XH, Guan XW, Feng SL, Ma YZ, Chen SW, Hui L.. (2017) One-pot synthesis and biological evaluation of N-(aminosulfonyl)-4-podophyllotoxin carbamates as potential anticancer agents., 27 (13): [PMID:28512026 ] [10.1016/j.bmcl.2017.04.082 ]