N4-Dodecyl-N2-(2-dimethylaminoethyl)pyrimidine-2,4-diamine

ID: ALA4094056

PubChem CID: 137655412

Max Phase: Preclinical

Molecular Formula: C20H39N5

Molecular Weight: 349.57

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CCCCCCCCCCCCNc1ccnc(NCCN(C)C)n1

Standard InChI:  InChI=1S/C20H39N5/c1-4-5-6-7-8-9-10-11-12-13-15-21-19-14-16-22-20(24-19)23-17-18-25(2)3/h14,16H,4-13,15,17-18H2,1-3H3,(H2,21,22,23,24)

Standard InChI Key:  WTFJNTNHMJJVIH-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 25 25  0  0  0  0  0  0  0  0999 V2000
   10.9870  -12.3613    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.7018  -11.9658    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.7133  -11.1488    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.0142  -10.7273    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.2995  -11.1269    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.2880  -11.9440    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.9755  -13.1784    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   12.4280  -10.7533    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.2608  -13.5780    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.5617  -13.1565    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8470  -13.5562    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.1438  -13.1346    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8314  -14.3732    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.4436   -9.9362    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.7404   -9.5147    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.7561   -8.6977    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.0529   -8.2762    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.0685   -7.4591    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3654   -7.0418    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3769   -6.2247    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6778   -5.8032    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6893   -4.9862    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9903   -4.5688    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0018   -3.7476    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3027   -3.3302    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  3  4  1  0
  4  5  2  0
  5  6  1  0
  1  6  2  0
  1  7  1  0
  3  8  1  0
  9 10  1  0
 11 12  1  0
 11 13  1  0
 10 11  1  0
  7  9  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 21 22  1  0
 22 23  1  0
 23 24  1  0
 24 25  1  0
  8 14  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4094056

    ---

Associated Targets(Human)

DNM2 Tchem Dynamin-2 (62 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 349.57Molecular Weight (Monoisotopic): 349.3205AlogP: 4.78#Rotatable Bonds: 16
Polar Surface Area: 53.08Molecular Species: BASEHBA: 5HBD: 2
#RO5 Violations: HBA (Lipinski): 5HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 8.66CX LogP: 5.17CX LogD: 3.86
Aromatic Rings: 1Heavy Atoms: 25QED Weighted: 0.42Np Likeness Score: -0.95

References

1. Odell LR, Abdel-Hamid MK, Hill TA, Chau N, Young KA, Deane FM, Sakoff JA, Andersson S, Daniel JA, Robinson PJ, McCluskey A..  (2017)  Pyrimidine-Based Inhibitors of Dynamin I GTPase Activity: Competitive Inhibition at the Pleckstrin Homology Domain.,  60  (1): [PMID:27997171] [10.1021/acs.jmedchem.6b01422]

Source