The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
NA ID: ALA4094170
PubChem CID: 137655663
Max Phase: Preclinical
Molecular Formula: C31H29NO4
Molecular Weight: 479.58
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: O=C1/C(=C/c2ccccc2)C[C@@]2(O)[C@H]3Cc4ccc(O)c5c4[C@@]2(CCN3CCc2ccccc2)[C@H]1O5
Standard InChI: InChI=1S/C31H29NO4/c33-24-12-11-22-18-25-31(35)19-23(17-21-9-5-2-6-10-21)27(34)29-30(31,26(22)28(24)36-29)14-16-32(25)15-13-20-7-3-1-4-8-20/h1-12,17,25,29,33,35H,13-16,18-19H2/b23-17+/t25-,29+,30+,31-/m1/s1
Standard InChI Key: OLQFQZDEDRQEEF-QDTDKTDESA-N
Molfile:
RDKit 2D
38 44 0 0 0 0 0 0 0 0999 V2000
6.4137 -12.8976 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6048 -12.8976 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8223 -12.1960 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2086 -13.5910 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8099 -13.5910 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9721 -14.0697 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.3931 -11.4943 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2086 -12.1960 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6312 -12.1960 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6048 -11.4943 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4137 -10.6813 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.9969 -12.1918 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0398 -12.9017 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6230 -13.6033 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3955 -13.5910 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9969 -11.1972 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3955 -12.1960 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9869 -12.8976 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9786 -14.3050 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.0275 -14.3132 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.8182 -9.9631 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8058 -14.4990 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
7.2309 -11.4819 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.0947 -11.0899 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
8.8529 -12.9053 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2604 -12.1994 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0712 -12.2046 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4828 -11.5036 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0772 -10.7973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2599 -10.7964 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8561 -11.4979 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4075 -9.2632 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8058 -8.5560 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6196 -8.5516 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0219 -7.8453 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6071 -7.1443 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7898 -7.1541 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3954 -7.8610 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 1 1 0
4 2 2 0
5 1 1 0
6 5 1 0
7 3 1 0
8 2 1 0
9 3 1 0
10 7 1 0
11 16 1 0
1 12 1 1
13 14 1 0
14 5 1 0
15 4 1 0
16 12 1 0
17 8 2 0
18 17 1 0
19 15 1 0
14 20 2 0
21 11 1 0
5 22 1 1
3 23 1 1
7 24 1 6
4 6 1 0
7 11 1 0
9 13 1 0
8 10 1 0
18 15 2 0
13 25 2 0
25 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 26 1 0
21 32 1 0
32 33 1 0
33 34 2 0
34 35 1 0
35 36 2 0
36 37 1 0
37 38 2 0
38 33 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 479.58Molecular Weight (Monoisotopic): 479.2097AlogP: 4.05#Rotatable Bonds: 4Polar Surface Area: 70.00Molecular Species: BASEHBA: 5HBD: 2#RO5 Violations: ┄HBA (Lipinski): 5HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 10.14CX Basic pKa: 9.15CX LogP: 4.61CX LogD: 3.13Aromatic Rings: 3Heavy Atoms: 36QED Weighted: 0.55Np Likeness Score: 0.97
References 1. Healy JR, Bezawada P, Griggs NW, Devereaux AL, Matsumoto RR, Traynor JR, Coop A, Cunningham CW.. (2017) Benzylideneoxymorphone: A new lead for development of bifunctional mu/delta opioid receptor ligands., 27 (3): [PMID:28011222 ] [10.1016/j.bmcl.2016.11.057 ]