(S)-(3-Phenyl-2-((6-(p-tolyl)thieno[2,3-d]pyrimidin-4-yl)-amino)propanoyl)phosphoramidic Acid

ID: ALA4094213

PubChem CID: 124220689

Max Phase: Preclinical

Molecular Formula: C22H21N4O4PS

Molecular Weight: 468.48

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Cc1ccc(-c2cc3c(N[C@@H](Cc4ccccc4)C(=O)NP(=O)(O)O)ncnc3s2)cc1

Standard InChI:  InChI=1S/C22H21N4O4PS/c1-14-7-9-16(10-8-14)19-12-17-20(23-13-24-22(17)32-19)25-18(21(27)26-31(28,29)30)11-15-5-3-2-4-6-15/h2-10,12-13,18H,11H2,1H3,(H,23,24,25)(H3,26,27,28,29,30)/t18-/m0/s1

Standard InChI Key:  FWELKNKHGIBMRD-SFHVURJKSA-N

Molfile:  

     RDKit          2D

 32 35  0  0  0  0  0  0  0  0999 V2000
   35.3208  -17.4912    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   34.9164  -18.2011    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0
   35.7334  -18.1964    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   26.8496  -19.9555    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.6708  -19.9468    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.0687  -19.2293    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.8900  -19.2164    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.0900  -20.6472    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.9112  -20.6385    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.3091  -19.9210    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.1303  -19.9122    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.6007  -19.2391    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.3872  -19.4816    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.0877  -19.0625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.0790  -18.2454    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   32.7836  -17.8222    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.7707  -17.0051    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.4753  -16.5859    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.4665  -15.7647    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.1670  -15.3456    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.8845  -15.7435    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.8974  -16.5647    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.1928  -16.9839    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.4969  -18.2242    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.2015  -17.8051    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   33.5098  -19.0454    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   32.8052  -19.4646    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   32.8181  -20.2816    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.1135  -20.7049    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   31.3960  -20.3028    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.6200  -20.5695    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   34.9331  -19.0201    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  1  0
  4  5  1  0
  5  6  1  0
  6  7  2  0
  5  8  2  0
  8  9  1  0
  9 10  2  0
  7 10  1  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 16 15  1  1
 16 17  1  0
 17 18  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 18 23  1  0
 16 24  1  0
 24 25  1  0
 25  2  1  0
 24 26  2  0
 14 27  1  0
 27 28  2  0
 28 29  1  0
 29 30  2  0
 13 30  1  0
 30 31  1  0
 11 31  1  0
  2 32  2  0
M  END

Alternative Forms

  1. Parent:

    ALA4094213

    ---

Associated Targets(Human)

FDPS Tclin Farnesyl diphosphate synthase (1240 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 468.48Molecular Weight (Monoisotopic): 468.1021AlogP: 3.90#Rotatable Bonds: 7
Polar Surface Area: 124.44Molecular Species: ACIDHBA: 6HBD: 4
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 4#RO5 Violations (Lipinski):
CX Acidic pKa: 1.91CX Basic pKa: 3.83CX LogP: 1.92CX LogD: -0.75
Aromatic Rings: 4Heavy Atoms: 32QED Weighted: 0.30Np Likeness Score: -0.86

References

1. Park J, Leung CY, Matralis AN, Lacbay CM, Tsakos M, Fernandez De Troconiz G, Berghuis AM, Tsantrizos YS..  (2017)  Pharmacophore Mapping of Thienopyrimidine-Based Monophosphonate (ThP-MP) Inhibitors of the Human Farnesyl Pyrophosphate Synthase.,  60  (5): [PMID:28208018] [10.1021/acs.jmedchem.6b01888]

Source