The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
10-(3-N-piperidinopropyl)-2,4-dimethylacridone ID: ALA4094253
PubChem CID: 137655666
Max Phase: Preclinical
Molecular Formula: C23H28N2O
Molecular Weight: 348.49
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: Cc1cc(C)c2c(c1)c(=O)c1ccccc1n2CCCN1CCCCC1
Standard InChI: InChI=1S/C23H28N2O/c1-17-15-18(2)22-20(16-17)23(26)19-9-4-5-10-21(19)25(22)14-8-13-24-11-6-3-7-12-24/h4-5,9-10,15-16H,3,6-8,11-14H2,1-2H3
Standard InChI Key: PNTMVOCDOXQCIL-UHFFFAOYSA-N
Molfile:
RDKit 2D
26 29 0 0 0 0 0 0 0 0999 V2000
5.3773 -20.7435 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.3773 -19.1091 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0826 -19.5218 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0810 -20.3372 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7852 -20.7445 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4915 -20.3375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4891 -19.5190 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7843 -19.1154 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6720 -20.3390 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6746 -19.5236 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9708 -19.1155 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2641 -19.5216 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2655 -20.3401 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9698 -20.7446 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3759 -18.2919 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.7845 -21.5617 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1955 -19.1081 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3785 -21.5606 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6714 -21.9703 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6726 -22.7875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9655 -23.1971 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.2588 -22.7892 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5538 -23.1954 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5508 -24.0129 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2589 -24.4227 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9701 -24.0149 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10 2 1 0
9 1 1 0
1 4 1 0
3 2 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 7 1 0
7 8 2 0
8 3 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 13 1 0
13 14 2 0
14 9 1 0
2 15 2 0
5 16 1 0
7 17 1 0
1 18 1 0
18 19 1 0
19 20 1 0
20 21 1 0
21 22 1 0
21 26 1 0
22 23 1 0
23 24 1 0
24 25 1 0
25 26 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 348.49Molecular Weight (Monoisotopic): 348.2202AlogP: 4.65#Rotatable Bonds: 4Polar Surface Area: 25.24Molecular Species: BASEHBA: 3HBD: ┄#RO5 Violations: ┄HBA (Lipinski): 3HBD (Lipinski): ┄#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 8.81CX LogP: 5.08CX LogD: 3.66Aromatic Rings: 3Heavy Atoms: 26QED Weighted: 0.64Np Likeness Score: -0.87
References 1. Murahari M, Kharkar PS, Lonikar N, Mayur YC.. (2017) Design, synthesis, biological evaluation, molecular docking and QSAR studies of 2,4-dimethylacridones as anticancer agents., 130 [PMID:28246041 ] [10.1016/j.ejmech.2017.02.022 ]