10-(3-N-piperidinopropyl)-2,4-dimethylacridone

ID: ALA4094253

PubChem CID: 137655666

Max Phase: Preclinical

Molecular Formula: C23H28N2O

Molecular Weight: 348.49

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Cc1cc(C)c2c(c1)c(=O)c1ccccc1n2CCCN1CCCCC1

Standard InChI:  InChI=1S/C23H28N2O/c1-17-15-18(2)22-20(16-17)23(26)19-9-4-5-10-21(19)25(22)14-8-13-24-11-6-3-7-12-24/h4-5,9-10,15-16H,3,6-8,11-14H2,1-2H3

Standard InChI Key:  PNTMVOCDOXQCIL-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 26 29  0  0  0  0  0  0  0  0999 V2000
    5.3773  -20.7435    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.3773  -19.1091    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0826  -19.5218    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0810  -20.3372    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7852  -20.7445    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4915  -20.3375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4891  -19.5190    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7843  -19.1154    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6720  -20.3390    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6746  -19.5236    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9708  -19.1155    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2641  -19.5216    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2655  -20.3401    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9698  -20.7446    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3759  -18.2919    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.7845  -21.5617    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1955  -19.1081    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3785  -21.5606    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6714  -21.9703    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6726  -22.7875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9655  -23.1971    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.2588  -22.7892    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5538  -23.1954    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5508  -24.0129    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2589  -24.4227    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9701  -24.0149    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
 10  2  1  0
  9  1  1  0
  1  4  1  0
  3  2  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  7  1  0
  7  8  2  0
  8  3  1  0
  9 10  2  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14  9  1  0
  2 15  2  0
  5 16  1  0
  7 17  1  0
  1 18  1  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 21 22  1  0
 21 26  1  0
 22 23  1  0
 23 24  1  0
 24 25  1  0
 25 26  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4094253

    ---

Associated Targets(Human)

NCI/ADR-RES (33767 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
MCF7 (126967 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
ABCB1 Tchem P-glycoprotein 1 (14716 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 348.49Molecular Weight (Monoisotopic): 348.2202AlogP: 4.65#Rotatable Bonds: 4
Polar Surface Area: 25.24Molecular Species: BASEHBA: 3HBD:
#RO5 Violations: HBA (Lipinski): 3HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 8.81CX LogP: 5.08CX LogD: 3.66
Aromatic Rings: 3Heavy Atoms: 26QED Weighted: 0.64Np Likeness Score: -0.87

References

1. Murahari M, Kharkar PS, Lonikar N, Mayur YC..  (2017)  Design, synthesis, biological evaluation, molecular docking and QSAR studies of 2,4-dimethylacridones as anticancer agents.,  130  [PMID:28246041] [10.1016/j.ejmech.2017.02.022]

Source