Phenyl alpha-D-glucopyranoside-6-sulfate

ID: ALA4094282

PubChem CID: 137653299

Max Phase: Preclinical

Molecular Formula: C12H16O9S

Molecular Weight: 336.32

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=S(=O)(O)OC[C@H]1O[C@H](Oc2ccccc2)[C@H](O)[C@@H](O)[C@@H]1O

Standard InChI:  InChI=1S/C12H16O9S/c13-9-8(6-19-22(16,17)18)21-12(11(15)10(9)14)20-7-4-2-1-3-5-7/h1-5,8-15H,6H2,(H,16,17,18)/t8-,9-,10+,11-,12+/m1/s1

Standard InChI Key:  OJGNUJIVIQXMCX-ZIQFBCGOSA-N

Molfile:  

     RDKit          2D

 22 23  0  0  0  0  0  0  0  0999 V2000
   34.2560  -16.8308    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   35.0732  -16.8308    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   34.6646  -16.1231    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   33.6617  -19.2907    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.6617  -20.1079    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.3670  -20.5123    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.0722  -20.1079    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.0722  -19.2907    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   34.3670  -18.8779    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.3670  -18.0608    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.0747  -17.6522    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   35.7824  -16.4264    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   32.9528  -18.8841    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   32.9546  -20.5175    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   34.3670  -21.3295    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   35.7794  -20.5175    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   36.4877  -20.1099    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.1931  -20.5204    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.9009  -20.1135    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.9026  -19.2955    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.1905  -18.8860    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.4856  -19.2952    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  2  0
  4  5  1  0
  4  9  1  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
  9 10  1  1
 10 11  1  0
 11  2  1  0
  2 12  1  0
  4 13  1  6
  5 14  1  1
  6 15  1  6
  7 16  1  6
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 17  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4094282

    ---

Associated Targets(non-human)

Trehalose-phosphatase (56 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 336.32Molecular Weight (Monoisotopic): 336.0515AlogP: -1.31#Rotatable Bonds: 5
Polar Surface Area: 142.75Molecular Species: ACIDHBA: 8HBD: 4
#RO5 Violations: HBA (Lipinski): 9HBD (Lipinski): 4#RO5 Violations (Lipinski):
CX Acidic pKa: -1.97CX Basic pKa: CX LogP: -2.38CX LogD: -2.92
Aromatic Rings: 1Heavy Atoms: 22QED Weighted: 0.48Np Likeness Score: 1.63

References

1. Liu C, Dunaway-Mariano D, Mariano PS..  (2017)  Rational design of reversible inhibitors for trehalose 6-phosphate phosphatases.,  128  [PMID:28192710] [10.1016/j.ejmech.2017.02.001]

Source