(+)-(2S)-1-Benzyl-2-methyl-4-(4-phenylbutyl)-1,4-diazepane

ID: ALA4094304

PubChem CID: 137654284

Max Phase: Preclinical

Molecular Formula: C23H32N2

Molecular Weight: 336.52

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  C[C@H]1CN(CCCCc2ccccc2)CCCN1Cc1ccccc1

Standard InChI:  InChI=1S/C23H32N2/c1-21-19-24(16-9-8-13-22-11-4-2-5-12-22)17-10-18-25(21)20-23-14-6-3-7-15-23/h2-7,11-12,14-15,21H,8-10,13,16-20H2,1H3/t21-/m0/s1

Standard InChI Key:  ZRAMBHMSKOXJSM-NRFANRHFSA-N

Molfile:  

     RDKit          2D

 25 27  0  0  0  0  0  0  0  0999 V2000
   15.6777   -2.6688    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.4193   -2.3257    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.1578   -2.6884    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   15.4826   -3.4694    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.3345   -3.4891    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.9908   -4.1185    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   16.8131   -4.1243    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.1642   -4.8683    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.6304   -4.8519    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.8005   -2.1837    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.0853   -5.5308    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.7207   -6.2630    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.1749   -6.9414    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.9912   -6.8873    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.3511   -6.1489    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.8948   -5.4736    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.5590   -2.4879    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.2017   -1.9832    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.9601   -2.2874    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.6028   -1.7827    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.3578   -2.0882    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.0001   -1.5842    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.8847   -0.7743    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.1213   -0.4710    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.4822   -0.9768    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  1  4  1  0
  3  5  1  0
  4  6  1  0
  5  7  1  0
  6  7  1  0
  7  8  1  6
  6  9  1  0
  3 10  1  0
  9 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 16 11  1  0
 10 17  1  0
 17 18  1  0
 18 19  1  0
 19 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 20  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4094304

    ---

Associated Targets(non-human)

SIGMAR1 Sigma-1 receptor (3326 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Tmem97 Sigma intracellular receptor 2 (922 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
ERG2 C-8 sterol isomerase (237 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 336.52Molecular Weight (Monoisotopic): 336.2565AlogP: 4.61#Rotatable Bonds: 7
Polar Surface Area: 6.48Molecular Species: BASEHBA: 2HBD:
#RO5 Violations: HBA (Lipinski): 2HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 9.74CX LogP: 5.14CX LogD: 2.83
Aromatic Rings: 2Heavy Atoms: 25QED Weighted: 0.68Np Likeness Score: -0.86

References

1. Fanter L, Müller C, Schepmann D, Bracher F, Wünsch B..  (2017)  Chiral-pool synthesis of 1,2,4-trisubstituted 1,4-diazepanes as novel σ1 receptor ligands.,  25  (17): [PMID:28764962] [10.1016/j.bmc.2017.07.027]

Source