The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
3-Fluoro-9-methoxy-6-(3-(pyrrolidin-1-yl)propyl)-5H-pyrido-[3',2':4,5]cyclopenta[1,2-c]isoquinoline-5,11(6H)-dione ID: ALA4094373
PubChem CID: 137653301
Max Phase: Preclinical
Molecular Formula: C23H22FN3O3
Molecular Weight: 407.45
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: COc1cnc2c(c1)C(=O)c1c-2n(CCCN2CCCC2)c(=O)c2cc(F)ccc12
Standard InChI: InChI=1S/C23H22FN3O3/c1-30-15-12-18-20(25-13-15)21-19(22(18)28)16-6-5-14(24)11-17(16)23(29)27(21)10-4-9-26-7-2-3-8-26/h5-6,11-13H,2-4,7-10H2,1H3
Standard InChI Key: JSNXSAANPIBWQQ-UHFFFAOYSA-N
Molfile:
RDKit 2D
30 34 0 0 0 0 0 0 0 0999 V2000
15.3973 -6.3187 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.3961 -7.1383 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.1042 -7.5473 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.1024 -5.9099 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.8110 -6.3151 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.8098 -7.1358 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.5160 -7.5448 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.2279 -7.1378 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.5184 -5.9036 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.2273 -6.3130 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.6887 -5.1028 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.1420 -4.4954 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.5029 -5.0172 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.8337 -5.7647 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.6447 -5.8509 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
20.1258 -5.1903 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.7901 -4.4416 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.9801 -4.3591 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.5138 -8.3620 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.9349 -7.5476 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.9335 -8.3648 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.6405 -8.7746 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.6391 -9.5918 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
20.2686 -3.7791 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
21.0815 -3.8621 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.6881 -7.5463 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
18.9789 -10.0699 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.2301 -10.8476 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.0473 -10.8490 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.3010 -10.0722 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
5 9 1 0
6 7 1 0
7 8 1 0
8 10 1 0
9 10 2 0
10 14 1 0
13 11 1 0
11 9 1 0
11 12 2 0
13 14 2 0
14 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 13 1 0
7 19 2 0
8 20 1 0
20 21 1 0
21 22 1 0
22 23 1 0
17 24 1 0
24 25 1 0
2 26 1 0
23 27 1 0
27 28 1 0
28 29 1 0
29 30 1 0
30 23 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 407.45Molecular Weight (Monoisotopic): 407.1645AlogP: 3.24#Rotatable Bonds: 5Polar Surface Area: 64.43Molecular Species: NEUTRALHBA: 6HBD: ┄#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): ┄#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 8.34CX LogP: 1.76CX LogD: 0.77Aromatic Rings: 3Heavy Atoms: 30QED Weighted: 0.51Np Likeness Score: -0.63
References 1. Elsayed MSA, Su Y, Wang P, Sethi T, Agama K, Ravji A, Redon CE, Kiselev E, Horzmann KA, Freeman JL, Pommier Y, Cushman M.. (2017) Design and Synthesis of Chlorinated and Fluorinated 7-Azaindenoisoquinolines as Potent Cytotoxic Anticancer Agents That Inhibit Topoisomerase I., 60 (13): [PMID:28657311 ] [10.1021/acs.jmedchem.6b01870 ]