3-[(R)-4-Methyl-3,12-dioxo-7-(propane-2-sulfonyl)-13-oxa-4,11-diaza-tricyclo[14.2.2.1(6,10)]henicosa-1(19),6,8,10(21),16(20),17-hexaen-2-ylamino]-benzamide

ID: ALA4094405

PubChem CID: 57842911

Max Phase: Preclinical

Molecular Formula: C29H32N4O6S

Molecular Weight: 564.66

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CC(C)S(=O)(=O)c1ccc2cc1CN(C)C(=O)[C@H](Nc1cccc(C(N)=O)c1)c1ccc(cc1)CCOC(=O)N2

Standard InChI:  InChI=1S/C29H32N4O6S/c1-18(2)40(37,38)25-12-11-24-16-22(25)17-33(3)28(35)26(31-23-6-4-5-21(15-23)27(30)34)20-9-7-19(8-10-20)13-14-39-29(36)32-24/h4-12,15-16,18,26,31H,13-14,17H2,1-3H3,(H2,30,34)(H,32,36)/t26-/m1/s1

Standard InChI Key:  XSMZORAYDXSGBA-AREMUKBSSA-N

Molfile:  

     RDKit          2D

 40 43  0  0  0  0  0  0  0  0999 V2000
   14.0738  -10.9165    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.2567  -10.9165    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   13.6653  -11.6242    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.1791   -8.9391    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1774   -9.7204    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8527  -10.1078    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5303   -9.7197    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5304   -8.9339    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8501   -8.5477    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2060  -10.1091    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.8840   -9.7165    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.5597  -10.1059    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.2336   -9.7133    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.9093  -10.1027    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.5832   -9.7143    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.2590  -10.0999    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.9322   -9.7124    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.9310   -8.9291    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.2523   -8.5399    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.5792   -8.9349    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.2463   -7.7620    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   12.5686   -7.3762    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.5667   -6.5942    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.2126   -6.0228    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8751   -6.6004    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8784   -7.3824    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.5549   -7.7730    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.5563   -8.5498    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8822   -8.9386    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2075   -8.5562    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2012   -7.7772    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.8968   -7.7682    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.5575  -10.8838    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.5022  -10.1106    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8278   -9.7188    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.5012  -10.8885    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.2317   -8.8961    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.5536  -11.3270    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.5552  -12.1442    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.8452  -10.9197    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  2  0
  4  5  2  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  2  0
  9  4  1  0
  7 10  1  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 15  1  0
 19 21  1  0
 21 22  1  0
 22 23  1  0
 23 24  1  0
 25 24  1  0
 26 25  1  0
 27 26  2  0
 28 27  1  0
 29 28  2  0
 11 29  1  6
 30 29  1  0
 31 30  2  0
 26 31  1  0
 22 32  2  0
 12 33  2  0
  5 34  1  0
 34 35  1  0
 34 36  2  0
 13 37  1  0
 16  2  1  0
  2 38  1  0
 38 39  1  0
 38 40  1  0
M  END

Associated Targets(Human)

F7 Tchem Coagulation factor VII (948 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Plasma (7708 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 564.66Molecular Weight (Monoisotopic): 564.2043AlogP: 3.88#Rotatable Bonds: 5
Polar Surface Area: 147.90Molecular Species: NEUTRALHBA: 7HBD: 3
#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 4#RO5 Violations (Lipinski): 1
CX Acidic pKa: 12.53CX Basic pKa: 0.46CX LogP: 2.89CX LogD: 2.89
Aromatic Rings: 3Heavy Atoms: 40QED Weighted: 0.43Np Likeness Score: -0.33

References

1. Wurtz NR, Parkhurst BL, DeLucca I, Glunz PW, Jiang W, Zhang X, Cheney DL, Bozarth JM, Rendina AR, Wei A, Harper T, Luettgen JM, Wu Y, Wong PC, Seiffert DA, Wexler RR, Priestley ES..  (2017)  Neutral macrocyclic factor VIIa inhibitors.,  27  (12): [PMID:28460818] [10.1016/j.bmcl.2017.04.008]

Source