{N-(2-One-2-[4-(3-phenylsulfonyl-1,2,5-oxadiazole-2-oxide-4-)-oxy]butoxy)ethyl}piperidyl-4-oxy Benzoate

ID: ALA4094434

PubChem CID: 137655434

Max Phase: Preclinical

Molecular Formula: C26H29N3O8S

Molecular Weight: 543.60

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=C(CN1CCC(OC(=O)c2ccccc2)CC1)OCCCCOc1nonc1S(=O)(=O)c1ccccc1

Standard InChI:  InChI=1S/C26H29N3O8S/c30-23(19-29-15-13-21(14-16-29)36-26(31)20-9-3-1-4-10-20)34-17-7-8-18-35-24-25(28-37-27-24)38(32,33)22-11-5-2-6-12-22/h1-6,9-12,21H,7-8,13-19H2

Standard InChI Key:  BPPNVRPOWOKWBJ-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 38 41  0  0  0  0  0  0  0  0999 V2000
    4.7055  -17.6669    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.6720  -17.1999    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.4776  -17.3778    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   13.2290  -16.5912    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.7421  -18.4926    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4711  -18.8710    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1679  -18.4286    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.1309  -17.6035    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3970  -17.2208    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8997  -18.8097    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5956  -18.3665    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3273  -18.7475    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.5598  -17.5423    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.0232  -18.3044    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.7550  -18.6855    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.4509  -18.2422    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.1826  -18.6234    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.8784  -18.1802    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.6102  -18.5612    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.7285  -19.3776    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   13.5422  -19.5139    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.9233  -18.7822    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   13.3451  -18.1937    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.2533  -17.0905    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.8879  -17.6161    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.6598  -17.3273    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.7961  -16.5127    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.1542  -15.9876    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.3847  -16.2793    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9725  -17.2883    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.9338  -16.4642    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2009  -16.0856    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6283  -16.0186    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.1658  -15.2620    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4337  -14.8834    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7383  -15.3289    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7798  -16.1572    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5123  -16.5320    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  3  2  2  0
  4  3  2  0
  1  5  1  0
  1  9  1  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
  7 10  1  0
 10 11  1  0
 11 12  1  0
 11 13  2  0
 12 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  1  0
 22 23  2  0
 23 19  1  0
 23  3  1  0
  3 24  1  0
 24 25  2  0
 25 26  1  0
 26 27  2  0
 27 28  1  0
 28 29  2  0
 29 24  1  0
  1 30  1  0
 30 31  1  0
 31 32  1  0
 31 33  2  0
 32 34  2  0
 34 35  1  0
 35 36  2  0
 36 37  1  0
 37 38  2  0
 38 32  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4094434

    ---

Associated Targets(Human)

K562/A02 (383 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
K562 (73714 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 543.60Molecular Weight (Monoisotopic): 543.1675AlogP: 2.93#Rotatable Bonds: 12
Polar Surface Area: 138.13Molecular Species: NEUTRALHBA: 11HBD:
#RO5 Violations: 2HBA (Lipinski): 11HBD (Lipinski): #RO5 Violations (Lipinski): 2
CX Acidic pKa: CX Basic pKa: 6.38CX LogP: 3.58CX LogD: 3.54
Aromatic Rings: 3Heavy Atoms: 38QED Weighted: 0.25Np Likeness Score: -1.09

References

1. Gu X, Huang Z, Ren Z, Tang X, Xue R, Luo X, Peng S, Peng H, Lu B, Tian J, Zhang Y..  (2017)  Potent Inhibition of Nitric Oxide-Releasing Bifendate Derivatives against Drug-Resistant K562/A02 Cells in Vitro and in Vivo.,  60  (3): [PMID:28068095] [10.1021/acs.jmedchem.6b01075]

Source