The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Rac-N-cis(3-((2-((2-aminocyclohexyl)amino)-9-isopropyl-9H-purin-6-yl)amino)-5-chlorophenyl)acetamide ID: ALA4094492
PubChem CID: 134397388
Max Phase: Preclinical
Molecular Formula: C22H29ClN8O
Molecular Weight: 456.98
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CC(=O)Nc1cc(Cl)cc(Nc2nc(N[C@@H]3CCCC[C@@H]3N)nc3c2ncn3C(C)C)c1
Standard InChI: InChI=1S/C22H29ClN8O/c1-12(2)31-11-25-19-20(27-16-9-14(23)8-15(10-16)26-13(3)32)29-22(30-21(19)31)28-18-7-5-4-6-17(18)24/h8-12,17-18H,4-7,24H2,1-3H3,(H,26,32)(H2,27,28,29,30)/t17-,18+/m0/s1
Standard InChI Key: ZYFRJAWGLQYBTJ-ZWKOTPCHSA-N
Molfile:
RDKit 2D
32 35 0 0 0 0 0 0 0 0999 V2000
35.8088 -20.4258 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.8169 -19.6087 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.0958 -20.8244 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
36.5096 -20.8444 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
36.4975 -21.6615 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.2024 -22.0800 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.1902 -22.8971 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.4772 -23.2956 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.7764 -22.8771 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.7844 -22.0600 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.0633 -23.2756 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
37.8952 -23.3156 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
39.3660 -24.3080 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
39.8370 -24.9766 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.3479 -25.6302 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
38.5758 -25.3683 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.8628 -25.7669 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
37.1578 -25.3483 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.1700 -24.5313 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
37.8830 -24.1327 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.5839 -24.5513 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.5911 -26.4083 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.3783 -26.6330 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.0054 -26.9792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.4448 -25.7469 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
35.7439 -25.3283 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.0309 -25.7269 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.3301 -25.3083 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.3381 -24.4912 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.0512 -24.0927 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.7561 -24.5113 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.0187 -26.5440 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
1 3 2 0
1 4 1 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 10 1 0
5 10 2 0
9 11 1 0
13 14 2 0
14 15 1 0
15 16 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
13 21 1 0
16 21 1 0
22 23 1 0
22 24 1 0
15 22 1 0
26 27 1 0
27 28 1 0
28 29 1 0
29 30 1 0
30 31 1 0
26 31 1 0
27 32 1 1
26 25 1 1
18 25 1 0
12 20 1 0
7 12 1 0
4 5 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 456.98Molecular Weight (Monoisotopic): 456.2153AlogP: 4.44#Rotatable Bonds: 6Polar Surface Area: 122.78Molecular Species: BASEHBA: 8HBD: 4#RO5 Violations: ┄HBA (Lipinski): 9HBD (Lipinski): 5#RO5 Violations (Lipinski): ┄CX Acidic pKa: 13.56CX Basic pKa: 9.91CX LogP: 3.35CX LogD: 0.95Aromatic Rings: 3Heavy Atoms: 32QED Weighted: 0.43Np Likeness Score: -1.17
References 1. Shi Y, Park J, Lagisetti C, Zhou W, Sambucetti LC, Webb TR.. (2017) A triple exon-skipping luciferase reporter assay identifies a new CLK inhibitor pharmacophore., 27 (3): [PMID:28049589 ] [10.1016/j.bmcl.2016.12.056 ] 2. Shi Y, Park J, Lagisetti C, Zhou W, Sambucetti LC, Webb TR.. (2017) A triple exon-skipping luciferase reporter assay identifies a new CLK inhibitor pharmacophore., 27 (3): [PMID:28049589 ] [10.1016/j.bmcl.2016.12.056 ]