The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(3-((5-Nitro-2-(4-(3-(4-methylbenzenesulfonicamide)methyl)phenylamino)-4-pyrimidinyl)amino)phenyl)acrylamide ID: ALA4094611
PubChem CID: 137655908
Max Phase: Preclinical
Molecular Formula: C27H25N7O5S
Molecular Weight: 559.61
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: C=CC(=O)Nc1cccc(Nc2nc(Nc3ccc(NS(=O)(=O)c4ccc(C)cc4)c(C)c3)ncc2[N+](=O)[O-])c1
Standard InChI: InChI=1S/C27H25N7O5S/c1-4-25(35)29-19-6-5-7-20(15-19)30-26-24(34(36)37)16-28-27(32-26)31-21-10-13-23(18(3)14-21)33-40(38,39)22-11-8-17(2)9-12-22/h4-16,33H,1H2,2-3H3,(H,29,35)(H2,28,30,31,32)
Standard InChI Key: WEOSNZZPTRHAKX-UHFFFAOYSA-N
Molfile:
RDKit 2D
40 43 0 0 0 0 0 0 0 0999 V2000
32.1429 -6.1991 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
32.9600 -6.1991 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
32.5515 -5.4914 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
34.3784 -1.2959 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
34.3773 -2.1154 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.0853 -2.5244 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
35.7950 -2.1150 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.7921 -1.2923 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.0835 -0.8871 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.5033 -2.5225 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
36.5046 -3.3397 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.6692 -2.5235 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
33.6686 -3.3407 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.9604 -3.7472 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.9594 -4.5636 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.6674 -4.9736 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.3777 -4.5611 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.3752 -3.7461 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.7962 -3.7478 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.7972 -4.5642 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.5060 -4.9725 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.2154 -4.5584 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.2110 -3.7434 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.9252 -4.9634 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
37.9294 -5.7806 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.6392 -6.1856 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.2238 -6.1928 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
38.6433 -7.0028 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.6678 -5.7908 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
32.9607 -7.0169 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.2512 -7.4231 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.2513 -8.2396 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.9597 -8.6486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.6695 -8.2352 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.6660 -7.4201 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.4959 -0.8797 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
36.4928 -0.0626 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
37.2051 -1.2857 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
35.0866 -4.9678 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.9612 -9.4658 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
4 5 2 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 4 1 0
7 10 1 0
10 11 1 0
5 12 1 0
12 13 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 13 1 0
11 19 2 0
19 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 11 1 0
22 24 1 0
24 25 1 0
25 26 1 0
25 27 2 0
26 28 2 0
16 29 1 0
29 2 1 0
2 30 1 0
30 31 2 0
31 32 1 0
32 33 2 0
33 34 1 0
34 35 2 0
35 30 1 0
36 37 2 0
36 38 1 0
8 36 1 0
17 39 1 0
33 40 1 0
M CHG 2 36 1 38 -1
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 559.61Molecular Weight (Monoisotopic): 559.1638AlogP: 5.41#Rotatable Bonds: 10Polar Surface Area: 168.25Molecular Species: NEUTRALHBA: 9HBD: 4#RO5 Violations: 2HBA (Lipinski): 12HBD (Lipinski): 4#RO5 Violations (Lipinski): 3CX Acidic pKa: 8.47CX Basic pKa: 1.95CX LogP: 6.95CX LogD: 6.92Aromatic Rings: 4Heavy Atoms: 40QED Weighted: 0.11Np Likeness Score: -1.79
References 1. Liu H, Qu M, Xu L, Han X, Wang C, Shu X, Yao J, Liu K, Peng J, Li Y, Ma X.. (2017) Design and synthesis of sulfonamide-substituted diphenylpyrimidines (SFA-DPPYs) as potent Bruton's tyrosine kinase (BTK) inhibitors with improved activity toward B-cell lymphoblastic leukemia., 135 [PMID:28432946 ] [10.1016/j.ejmech.2017.04.037 ]