The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(S)-5-(7-fluorofuro[3,2-c]pyridin-2-yl)-5-((6-methoxy-1-oxoisoindolin-2-yl)methyl)imidazolidine-2,4-dione ID: ALA4094984
PubChem CID: 57561300
Max Phase: Preclinical
Molecular Formula: C20H15FN4O5
Molecular Weight: 410.36
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc2c(c1)C(=O)N(C[C@@]1(c3cc4cncc(F)c4o3)NC(=O)NC1=O)C2
Standard InChI: InChI=1S/C20H15FN4O5/c1-29-12-3-2-10-8-25(17(26)13(10)5-12)9-20(18(27)23-19(28)24-20)15-4-11-6-22-7-14(21)16(11)30-15/h2-7H,8-9H2,1H3,(H2,23,24,27,28)/t20-/m0/s1
Standard InChI Key: GMSRLCIXQIMHEQ-FQEVSTJZSA-N
Molfile:
RDKit 2D
30 34 0 0 0 0 0 0 0 0999 V2000
8.9974 -14.4618 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5929 -15.1717 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4099 -15.1670 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5239 -15.9518 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.3411 -15.9518 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9325 -14.6929 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.2738 -15.1751 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8225 -15.8724 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.4994 -16.6183 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6406 -15.9507 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1828 -15.3393 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.8152 -16.7490 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1116 -17.1599 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1166 -17.9728 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8245 -18.3758 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5288 -17.9600 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5203 -17.1484 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2406 -18.3614 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.2489 -19.1785 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8221 -16.6124 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.4965 -14.9229 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.8089 -14.3673 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.6603 -13.7129 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2587 -13.1607 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9712 -13.5668 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6771 -13.1530 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6717 -12.3331 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9545 -11.9289 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.2516 -12.3451 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.3875 -13.5569 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 1
3 2 1 0
4 5 1 0
5 2 1 0
2 6 1 0
6 7 1 0
7 4 1 0
3 8 1 0
8 9 1 0
9 13 1 0
12 10 1 0
10 8 1 0
10 11 2 0
12 13 2 0
13 14 1 0
14 15 2 0
15 16 1 0
16 17 2 0
17 12 1 0
16 18 1 0
18 19 1 0
5 20 2 0
7 21 2 0
1 22 1 0
22 25 1 0
24 23 1 0
23 1 2 0
24 25 2 0
25 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 24 1 0
26 30 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 410.36Molecular Weight (Monoisotopic): 410.1026AlogP: 1.67#Rotatable Bonds: 4Polar Surface Area: 113.77Molecular Species: NEUTRALHBA: 6HBD: 2#RO5 Violations: ┄HBA (Lipinski): 9HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 8.62CX Basic pKa: 1.52CX LogP: 0.26CX LogD: 0.23Aromatic Rings: 3Heavy Atoms: 30QED Weighted: 0.63Np Likeness Score: -0.35
References 1. Tong L, Kim SH, Rosner K, Yu W, Shankar BB, Chen L, Li D, Dai C, Girijavallabhan V, Popovici-Muller J, Yang L, Zhou G, Kosinski A, Siddiqui MA, Shih NY, Guo Z, Orth P, Chen S, Lundell D, Niu X, Umland S, Kozlowski JA.. (2017) Fused bi-heteroaryl substituted hydantoin compounds as TACE inhibitors., 27 (14): [PMID:28558971 ] [10.1016/j.bmcl.2017.05.062 ]