The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(Z)-7-((1R,2R,3R)-2-((S,E)-3-(2-(4,4-diphosphonobutylthio)acetoxy)oct-1-enyl)-3-hydroxy-5-oxocyclopentyl)hept-5-enoic acid ID: ALA4094989
PubChem CID: 9939839
Max Phase: Preclinical
Molecular Formula: C26H44O12P2S
Molecular Weight: 642.64
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCCCC[C@@H](/C=C/[C@H]1[C@H](O)CC(=O)[C@@H]1C/C=C\CCCC(=O)O)OC(=O)CSCCCC(P(=O)(O)O)P(=O)(O)O
Standard InChI: InChI=1S/C26H44O12P2S/c1-2-3-6-10-19(38-25(31)18-41-16-9-13-26(39(32,33)34)40(35,36)37)14-15-21-20(22(27)17-23(21)28)11-7-4-5-8-12-24(29)30/h4,7,14-15,19-21,23,26,28H,2-3,5-6,8-13,16-18H2,1H3,(H,29,30)(H2,32,33,34)(H2,35,36,37)/b7-4-,15-14+/t19-,20+,21+,23+/m0/s1
Standard InChI Key: XERJJNDHXYZGQY-JSFDOGTHSA-N
Molfile:
RDKit 2D
41 41 0 0 0 0 0 0 0 0999 V2000
31.8911 -18.9233 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
31.8952 -19.7405 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0
32.6009 -19.3284 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
30.1659 -21.1479 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
30.7479 -20.5701 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0
29.9565 -20.3550 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
24.4703 -15.4482 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.2875 -15.4482 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.5419 -14.6715 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.8789 -14.1894 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.2202 -14.6715 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.3194 -14.4201 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.4904 -13.6210 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.2680 -13.3695 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.8745 -13.9172 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.6520 -13.6658 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.2586 -14.2134 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.0361 -13.9620 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.6427 -14.5096 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
30.2071 -13.1629 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
25.7671 -16.1099 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.5799 -16.0255 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.0594 -16.6871 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.8722 -16.6027 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.7262 -17.4333 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
28.3518 -17.2643 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.1646 -17.1799 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.6442 -17.8415 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.4570 -17.7571 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.2057 -18.0950 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.8725 -18.8411 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
28.0186 -18.0105 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.4981 -18.6722 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
29.3109 -18.5877 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.7905 -19.2494 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.6033 -19.1649 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.0829 -19.8266 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.3753 -20.4038 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
31.2292 -21.2344 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
23.9891 -16.1087 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
24.8777 -13.3722 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 2 1 0
5 4 1 0
6 5 1 0
7 8 1 0
8 9 1 0
9 10 1 0
10 11 1 0
11 7 1 0
9 12 1 6
12 13 1 0
13 14 2 0
14 15 1 0
15 16 1 0
16 17 1 0
17 18 1 0
18 19 1 0
18 20 2 0
8 21 1 1
21 22 2 0
22 23 1 0
23 24 1 0
23 25 1 6
24 26 1 0
26 27 1 0
27 28 1 0
28 29 1 0
25 30 1 0
30 31 2 0
30 32 1 0
32 33 1 0
33 34 1 0
34 35 1 0
35 36 1 0
36 37 1 0
37 2 1 0
37 5 1 0
2 38 2 0
5 39 2 0
7 40 1 6
10 41 2 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 642.64Molecular Weight (Monoisotopic): 642.2029AlogP: 4.00#Rotatable Bonds: 21Polar Surface Area: 215.96Molecular Species: ACIDHBA: 8HBD: 6#RO5 Violations: 2HBA (Lipinski): 12HBD (Lipinski): 6#RO5 Violations (Lipinski): 3CX Acidic pKa: 1.21CX Basic pKa: ┄CX LogP: 1.98CX LogD: -5.74Aromatic Rings: ┄Heavy Atoms: 41QED Weighted: 0.05Np Likeness Score: 1.13
References 1. Xie H, Chen G, Young RN.. (2017) Design, Synthesis, and Pharmacokinetics of a Bone-Targeting Dual-Action Prodrug for the Treatment of Osteoporosis., 60 (16): [PMID:28699744 ] [10.1021/acs.jmedchem.6b00951 ]