The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(2,6-Difluoro-3-hydroxy-phenyl)-(5-(4-methoxy-3-(morpholine-4-sulfonyl)-phenyl)-thiophen-2-yl)-methanone ID: ALA4095004
PubChem CID: 122653012
Max Phase: Preclinical
Molecular Formula: C22H19F2NO6S2
Molecular Weight: 495.53
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(-c2ccc(C(=O)c3c(F)ccc(O)c3F)s2)cc1S(=O)(=O)N1CCOCC1
Standard InChI: InChI=1S/C22H19F2NO6S2/c1-30-16-5-2-13(12-19(16)33(28,29)25-8-10-31-11-9-25)17-6-7-18(32-17)22(27)20-14(23)3-4-15(26)21(20)24/h2-7,12,26H,8-11H2,1H3
Standard InChI Key: JVTKSOWJHPPTJU-UHFFFAOYSA-N
Molfile:
RDKit 2D
33 36 0 0 0 0 0 0 0 0999 V2000
9.2367 -21.8000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.5310 -22.2127 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
9.2413 -22.6176 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.5397 -22.4727 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5386 -23.2923 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2466 -23.7012 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9563 -23.2918 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9535 -22.4691 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2449 -22.0639 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2424 -21.2467 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9489 -20.8360 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5335 -20.8402 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.7009 -21.1661 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
6.2459 -20.5571 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8352 -19.8506 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0364 -20.0230 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0547 -20.6376 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3886 -21.3847 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2008 -21.4680 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6800 -20.8050 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3413 -20.0566 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5301 -19.9770 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6596 -22.0579 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
2.8319 -22.0643 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
2.8306 -23.7003 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.0563 -22.8760 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.2463 -22.7864 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7681 -23.4447 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0986 -24.1924 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.9123 -24.2779 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3955 -23.6156 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4931 -20.8869 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.9705 -20.2237 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
4 5 2 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 4 1 0
9 10 1 0
10 11 1 0
10 12 2 0
11 13 1 0
13 14 1 0
14 15 2 0
15 16 1 0
16 11 2 0
17 18 2 0
18 19 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 17 1 0
14 17 1 0
8 23 1 0
4 24 1 0
5 25 1 0
19 2 1 0
2 26 1 0
26 27 1 0
26 31 1 0
27 28 1 0
28 29 1 0
29 30 1 0
30 31 1 0
20 32 1 0
32 33 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 495.53Molecular Weight (Monoisotopic): 495.0622AlogP: 3.66#Rotatable Bonds: 6Polar Surface Area: 93.14Molecular Species: NEUTRALHBA: 7HBD: 1#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 7.72CX Basic pKa: ┄CX LogP: 3.65CX LogD: 3.48Aromatic Rings: 3Heavy Atoms: 33QED Weighted: 0.52Np Likeness Score: -1.40
References 1. Abdelsamie AS, van Koppen CJ, Bey E, Salah M, Börger C, Siebenbürger L, Laschke MW, Menger MD, Frotscher M.. (2017) Treatment of estrogen-dependent diseases: Design, synthesis and profiling of a selective 17β-HSD1 inhibitor with sub-nanomolar IC50 for a proof-of-principle study., 127 [PMID:27852458 ] [10.1016/j.ejmech.2016.11.004 ]