The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-[[2-[4-(Aminomethyl)-1-piperidyl]-2-oxo-ethyl]-[(3-fluoro-4-methoxy-phenyl)methyl]amino]benzonitrile ID: ALA4095018
PubChem CID: 137654538
Max Phase: Preclinical
Molecular Formula: C23H27FN4O2
Molecular Weight: 410.49
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(CN(CC(=O)N2CCC(CN)CC2)c2ccc(C#N)cc2)cc1F
Standard InChI: InChI=1S/C23H27FN4O2/c1-30-22-7-4-19(12-21(22)24)15-28(20-5-2-17(13-25)3-6-20)16-23(29)27-10-8-18(14-26)9-11-27/h2-7,12,18H,8-11,14-16,26H2,1H3
Standard InChI Key: XDSLEWVHSUVCPM-UHFFFAOYSA-N
Molfile:
RDKit 2D
30 32 0 0 0 0 0 0 0 0999 V2000
16.0040 -12.0267 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.0028 -12.8462 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.7109 -13.2552 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.4205 -12.8458 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.4177 -12.0231 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.7091 -11.6178 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.2990 -13.2541 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.5910 -13.6621 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.1239 -11.6118 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.8331 -12.0178 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.5393 -11.6065 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.2485 -12.0124 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.5362 -10.7893 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.1208 -10.7947 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.4115 -10.3887 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.4100 -9.5710 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.0002 -10.3978 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.7091 -10.8000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.9944 -9.5764 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.6974 -9.1642 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.2493 -12.8282 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.9544 -13.2340 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.6630 -12.8262 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.6619 -12.0081 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.9522 -11.5977 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.3707 -13.2348 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.0784 -12.8263 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.2839 -9.1727 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.2783 -8.3556 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.6926 -8.3470 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
7 8 3 0
2 7 1 0
5 9 1 0
9 10 1 0
10 11 1 0
11 12 1 0
11 13 2 0
9 14 1 0
14 15 1 0
15 16 2 0
16 20 1 0
19 17 1 0
17 18 2 0
18 15 1 0
19 20 2 0
12 21 1 0
12 25 1 0
21 22 1 0
22 23 1 0
23 24 1 0
24 25 1 0
23 26 1 0
26 27 1 0
19 28 1 0
28 29 1 0
20 30 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 410.49Molecular Weight (Monoisotopic): 410.2118AlogP: 2.91#Rotatable Bonds: 7Polar Surface Area: 82.59Molecular Species: BASEHBA: 5HBD: 1#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 9.92CX LogP: 2.44CX LogD: 0.03Aromatic Rings: 2Heavy Atoms: 30QED Weighted: 0.76Np Likeness Score: -1.76
References 1. Mould DP, Alli C, Bremberg U, Cartic S, Jordan AM, Geitmann M, Maiques-Diaz A, McGonagle AE, Somervaille TCP, Spencer GJ, Turlais F, Ogilvie D.. (2017) Development of (4-Cyanophenyl)glycine Derivatives as Reversible Inhibitors of Lysine Specific Demethylase 1., 60 (19): [PMID:28892629 ] [10.1021/acs.jmedchem.7b00462 ]