The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2,6-Dimethoxy-4-formylphenyl beta-D-glucopyranoside-6-sulfate ID: ALA4095033
PubChem CID: 137655005
Max Phase: Preclinical
Molecular Formula: C15H20O12S
Molecular Weight: 424.38
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc(C=O)cc(OC)c1O[C@@H]1O[C@H](COS(=O)(=O)O)[C@@H](O)[C@H](O)[C@H]1O
Standard InChI: InChI=1S/C15H20O12S/c1-23-8-3-7(5-16)4-9(24-2)14(8)27-15-13(19)12(18)11(17)10(26-15)6-25-28(20,21)22/h3-5,10-13,15,17-19H,6H2,1-2H3,(H,20,21,22)/t10-,11-,12+,13-,15+/m1/s1
Standard InChI Key: HZUOEAKEJZLEHE-VVSAWPALSA-N
Molfile:
RDKit 2D
28 29 0 0 0 0 0 0 0 0999 V2000
3.4256 -8.3287 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.0211 -9.0386 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
3.8381 -9.0340 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.0253 -11.4943 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0253 -12.3115 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7305 -12.7160 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4358 -12.3115 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4358 -11.4943 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.7305 -11.0816 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7305 -10.2644 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0228 -9.8558 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.7305 -13.5332 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.3181 -12.7211 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.3164 -11.0878 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.1429 -12.7211 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.8512 -12.3136 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5567 -12.7241 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2645 -12.3172 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2662 -11.4991 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5541 -11.0897 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8492 -11.4989 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3151 -8.6300 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.1404 -11.0921 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.1384 -10.2749 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5546 -13.5413 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.2612 -13.9517 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9739 -11.0906 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9740 -10.2734 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
4 5 1 0
4 9 1 0
5 6 1 0
6 7 1 0
7 8 1 0
8 9 1 0
9 10 1 1
10 11 1 0
6 12 1 6
5 13 1 1
4 14 1 6
7 15 1 1
15 16 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 16 1 0
11 2 1 0
2 22 1 0
21 23 1 0
23 24 1 0
17 25 1 0
25 26 1 0
19 27 1 0
27 28 2 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 424.38Molecular Weight (Monoisotopic): 424.0675AlogP: -1.48#Rotatable Bonds: 8Polar Surface Area: 178.28Molecular Species: ACIDHBA: 11HBD: 4#RO5 Violations: 1HBA (Lipinski): 12HBD (Lipinski): 4#RO5 Violations (Lipinski): 1CX Acidic pKa: -2.36CX Basic pKa: ┄CX LogP: -3.22CX LogD: -3.52Aromatic Rings: 1Heavy Atoms: 28QED Weighted: 0.28Np Likeness Score: 1.62
References 1. Liu C, Dunaway-Mariano D, Mariano PS.. (2017) Rational design of reversible inhibitors for trehalose 6-phosphate phosphatases., 128 [PMID:28192710 ] [10.1016/j.ejmech.2017.02.001 ]