N-(2-methyl-1-(1-methylpiperidin-4-ylamino)-1-oxopropan-2-yl)-4-(4-(2-methyl-5-((2S,3R,4R,6R)-3,4,5-trihydroxy-6-(methylthio)tetrahydro-2H-pyran-2-yl)benzyl)phenyl)butanamide

ID: ALA4095070

PubChem CID: 117642291

Max Phase: Preclinical

Molecular Formula: C34H49N3O6S

Molecular Weight: 627.85

Molecule Type: Small molecule

Names and Identifiers

Canonical SMILES:  CS[C@H]1O[C@@H](c2ccc(C)c(Cc3ccc(CCCC(=O)NC(C)(C)C(=O)NC4CCN(C)CC4)cc3)c2)[C@H](O)[C@@H](O)[C@@H]1O

Standard InChI:  InChI=1S/C34H49N3O6S/c1-21-9-14-24(31-29(40)28(39)30(41)32(43-31)44-5)20-25(21)19-23-12-10-22(11-13-23)7-6-8-27(38)36-34(2,3)33(42)35-26-15-17-37(4)18-16-26/h9-14,20,26,28-32,39-41H,6-8,15-19H2,1-5H3,(H,35,42)(H,36,38)/t28-,29-,30+,31+,32-/m1/s1

Standard InChI Key:  NKIXUWMHDOVYEY-DSSMMGBBSA-N

Molfile:  

     RDKit          2D

 44 47  0  0  0  0  0  0  0  0999 V2000
   26.1921  -20.1419    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.7837  -19.4295    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.3708  -20.1393    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.0740  -19.4294    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.0729  -20.2568    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.7876  -20.6696    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.5041  -20.2563    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.5013  -19.4257    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.7858  -19.0167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.2192  -20.6677    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.9331  -20.2541    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.6448  -20.6659    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.3582  -20.2530    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.3574  -19.4271    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.6372  -19.0159    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.9268  -19.4312    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.0711  -20.6626    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.0700  -21.4886    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.7809  -21.9002    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.4974  -21.4904    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.4985  -20.6645    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.7831  -20.2482    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   37.2139  -20.2537    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   37.9274  -20.6678    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.2107  -21.9048    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   35.7787  -22.7252    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   34.3551  -21.9002    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   32.2096  -19.0233    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.3594  -19.0171    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.6450  -19.4298    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.9305  -19.0174    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.2161  -19.4301    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.5015  -19.0178    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   27.2163  -20.2551    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   25.0726  -19.0181    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.3582  -19.4308    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   25.0724  -18.1931    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   23.6447  -19.0175    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.6508  -18.1926    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.9415  -17.7794    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.2244  -18.1871    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   22.2212  -19.0126    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.9351  -19.4304    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.5120  -17.7709    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  1  0
  4  5  2  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  2  0
  9  4  1  0
  7 10  1  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 16 11  1  0
 17 18  1  0
 17 22  1  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 21 22  1  0
 17 13  1  6
 21 23  1  6
 23 24  1  0
 20 25  1  1
 19 26  1  6
 18 27  1  1
 16 28  1  0
  4 29  1  0
 29 30  1  0
 30 31  1  0
 31 32  1  0
 32 33  1  0
 32 34  2  0
 33  2  1  0
  2 35  1  0
 35 36  1  0
 35 37  2  0
 36 38  1  0
 38 39  1  0
 38 43  1  0
 39 40  1  0
 40 41  1  0
 41 42  1  0
 42 43  1  0
 41 44  1  0
M  END

Alternative Forms

1. Parent:

   

   ALA4095070

   US9688710, 147 N-(2-methyl-1-((1-methylpiperidin-4-yl)amino)-1-oxopropan-2-yl)-4-(4-(2-methyl-5-((2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-(methylthio)tetrahydro-2H-pyran-2-yl)benzyl)phenyl)butanamide

Molecule Features

Natural Product: No

Oral: No

Chemical Probe: No

Parenteral: No

Molecule Type: Small molecule

Topical: No

First In Class: No

Black Box: No

Chirality: No

Availability: No

Prodrug: No

Calculated Properties

Molecular Weight: 627.85

Molecular Weight (Monoisotopic): 627.3342

AlogP: 2.86

#Rotatable Bonds: 11

Polar Surface Area: 131.36

Molecular Species: BASE

HBA: 8

HBD: 5

#RO5 Violations: 1

HBA (Lipinski): 9

HBD (Lipinski): 5

#RO5 Violations (Lipinski): 1

CX Acidic pKa: 12.35

CX Basic pKa: 8.57

CX LogP: 3.31

CX LogD: 2.11

Aromatic Rings: 2

Heavy Atoms: 44

QED Weighted: 0.26

Np Likeness Score: -0.18

References

1. Goodwin NC, Ding ZM, Harrison BA, Strobel ED, Harris AL, Smith M, Thompson AY, Xiong W, Mseeh F, Bruce DJ, Diaz D, Gopinathan S, Li L, O'Neill E, Thiel M, Wilson AG, Carson KG, Powell DR, Rawlins DB..  (2017)  Discovery of LX2761, a Sodium-Dependent Glucose Cotransporter 1 (SGLT1) Inhibitor Restricted to the Intestinal Lumen, for the Treatment of Diabetes.,  60  (2): [PMID:28045524] [10.1021/acs.jmedchem.6b01541]

Source

Source(1):

• Scientific Literature