The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4alpha-acetylsalicylate-4-desoxypodophyllotoxin ID: ALA4095266
PubChem CID: 137653108
Max Phase: Preclinical
Molecular Formula: C31H28O11
Molecular Weight: 576.55
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc([C@@H]2c3cc4c(cc3[C@H](OC(=O)c3ccccc3OC(C)=O)[C@H]3COC(=O)[C@H]23)OCO4)cc(OC)c1OC
Standard InChI: InChI=1S/C31H28O11/c1-15(32)41-21-8-6-5-7-17(21)30(33)42-28-19-12-23-22(39-14-40-23)11-18(19)26(27-20(28)13-38-31(27)34)16-9-24(35-2)29(37-4)25(10-16)36-3/h5-12,20,26-28H,13-14H2,1-4H3/t20-,26+,27-,28-/m0/s1
Standard InChI Key: TVDMDRTUVPTSIL-XERNUKRASA-N
Molfile:
RDKit 2D
44 49 0 0 0 0 0 0 0 0999 V2000
10.9206 -8.0564 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4968 -8.8777 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.9206 -8.8777 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2066 -9.2863 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4968 -8.0564 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2066 -7.6395 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2066 -10.1076 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7048 -9.1253 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7786 -9.2863 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7786 -7.6436 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1984 -11.7461 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.1836 -8.4649 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.7048 -7.8005 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4885 -11.3375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.9083 -11.3292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0687 -8.0564 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0687 -8.8777 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4885 -10.5162 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.9083 -10.5162 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2969 -9.1377 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.2846 -7.8046 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.8141 -8.4773 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9525 -9.9095 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.2066 -6.8182 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.1984 -12.5674 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.7786 -11.7378 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.6181 -11.7378 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.4885 -12.9801 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0646 -11.3292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6181 -12.5592 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.9165 -9.6949 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
10.9165 -7.2350 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
9.4989 -6.4096 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4989 -5.5924 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7912 -6.8182 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.2100 -5.1875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2104 -4.3711 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5021 -3.9617 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7921 -4.3747 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7952 -5.1898 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0891 -5.6011 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.3798 -5.1952 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6737 -5.6066 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3766 -4.3781 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2 5 1 0
3 1 1 0
4 3 1 0
5 6 1 0
6 1 1 0
4 7 1 6
8 3 1 0
9 2 2 0
10 5 2 0
11 15 1 0
12 13 1 0
13 1 1 0
14 18 1 0
15 19 2 0
16 10 1 0
17 16 2 0
18 7 2 0
19 7 1 0
20 17 1 0
21 16 1 0
22 21 1 0
23 8 2 0
6 24 1 6
25 11 1 0
26 14 1 0
27 15 1 0
28 25 1 0
29 26 1 0
30 27 1 0
3 31 1 1
1 32 1 6
8 12 1 0
2 4 1 0
17 9 1 0
14 11 2 0
22 20 1 0
24 33 1 0
33 34 1 0
33 35 2 0
34 36 2 0
36 37 1 0
37 38 2 0
38 39 1 0
39 40 2 0
40 34 1 0
40 41 1 0
41 42 1 0
42 43 1 0
42 44 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 576.55Molecular Weight (Monoisotopic): 576.1632AlogP: 4.20#Rotatable Bonds: 7Polar Surface Area: 125.05Molecular Species: NEUTRALHBA: 11HBD: ┄#RO5 Violations: 2HBA (Lipinski): 11HBD (Lipinski): ┄#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 3.73CX LogD: 3.73Aromatic Rings: 3Heavy Atoms: 42QED Weighted: 0.30Np Likeness Score: 1.07
References 1. Zhang L, Liu L, Zheng C, Wang Y, Nie X, Shi D, Chen Y, Wei G, Wang J.. (2017) Synthesis and biological evaluation of novel podophyllotoxin-NSAIDs conjugates as multifunctional anti-MDR agents against resistant human hepatocellular carcinoma Bel-7402/5-FU cells., 131 [PMID:28301815 ] [10.1016/j.ejmech.2017.03.011 ]