The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(E)-N-(4-(3-([1,4'-bipiperidin]-1'-yl)prop-1-en-1-yl)benzyl)-2-methoxy-N-neopentyl-pyrimidin-4-amine ID: ALA4095336
PubChem CID: 137653125
Max Phase: Preclinical
Molecular Formula: C30H45N5O
Molecular Weight: 491.72
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: COc1nccc(N(Cc2ccc(/C=C/CN3CCC(N4CCCCC4)CC3)cc2)CC(C)(C)C)n1
Standard InChI: InChI=1S/C30H45N5O/c1-30(2,3)24-35(28-14-17-31-29(32-28)36-4)23-26-12-10-25(11-13-26)9-8-18-33-21-15-27(16-22-33)34-19-6-5-7-20-34/h8-14,17,27H,5-7,15-16,18-24H2,1-4H3/b9-8+
Standard InChI Key: HNPLGOVWPYYKGI-CMDGGOBGSA-N
Molfile:
RDKit 2D
36 39 0 0 0 0 0 0 0 0999 V2000
3.1600 -19.4186 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1589 -20.2422 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8711 -20.6512 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.5849 -20.2418 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5820 -19.4150 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.8693 -19.0056 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8668 -18.1843 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.5775 -17.7736 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1538 -17.7778 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1513 -16.9565 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4383 -16.5459 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8620 -16.5416 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1449 -16.1333 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2864 -18.1800 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2867 -18.9987 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9989 -19.4092 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7105 -18.9944 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7054 -18.1688 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9926 -17.7661 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4220 -19.4004 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1276 -18.9882 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8373 -19.3933 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5430 -18.9812 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.2521 -19.3892 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.9557 -18.9805 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.9558 -18.1630 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2462 -17.7558 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5365 -18.1661 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6589 -17.7556 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.3669 -18.1655 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0720 -17.7595 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0752 -16.9420 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.3672 -16.5321 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6559 -16.9397 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2927 -20.6501 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.2929 -21.4673 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
6 7 1 0
7 8 1 0
7 9 1 0
9 10 1 0
10 11 1 0
10 12 1 0
10 13 1 0
8 14 1 0
14 15 2 0
15 16 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 14 1 0
17 20 1 0
20 21 2 0
21 22 1 0
22 23 1 0
23 24 1 0
23 28 1 0
24 25 1 0
25 26 1 0
26 27 1 0
27 28 1 0
29 30 1 0
29 34 1 0
30 31 1 0
31 32 1 0
32 33 1 0
33 34 1 0
26 29 1 0
4 35 1 0
35 36 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 491.72Molecular Weight (Monoisotopic): 491.3624AlogP: 5.50#Rotatable Bonds: 9Polar Surface Area: 44.73Molecular Species: BASEHBA: 6HBD: ┄#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): ┄#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 10.05CX LogP: 6.05CX LogD: 3.41Aromatic Rings: 2Heavy Atoms: 36QED Weighted: 0.46Np Likeness Score: -0.98
References 1. Miltz W, Velcicky J, Dawson J, Littlewood-Evans A, Ludwig MG, Seuwen K, Feifel R, Oberhauser B, Meyer A, Gabriel D, Nash M, Loetscher P.. (2017) Design and synthesis of potent and orally active GPR4 antagonists with modulatory effects on nociception, inflammation, and angiogenesis., 25 (16): [PMID:28689977 ] [10.1016/j.bmc.2017.06.050 ]