1-(4-(1H-pyrrolo[2,3-b]pyridin-4-yloxy)phenyl)-3-(5-(4-methylpiperazin-1-yl)naphthalen-2-yl)urea

ID: ALA4095421

PubChem CID: 122235218

Max Phase: Preclinical

Molecular Formula: C29H28N6O2

Molecular Weight: 492.58

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CN1CCN(c2cccc3cc(NC(=O)Nc4ccc(Oc5ccnc6[nH]ccc56)cc4)ccc23)CC1

Standard InChI:  InChI=1S/C29H28N6O2/c1-34-15-17-35(18-16-34)26-4-2-3-20-19-22(7-10-24(20)26)33-29(36)32-21-5-8-23(9-6-21)37-27-12-14-31-28-25(27)11-13-30-28/h2-14,19H,15-18H2,1H3,(H,30,31)(H2,32,33,36)

Standard InChI Key:  WQRGBJPKMNUGRL-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 37 42  0  0  0  0  0  0  0  0999 V2000
   14.1579  -18.6929    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.1568  -19.5210    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   15.5866  -18.6892    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.8704  -18.2797    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.5894  -19.5206    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.8775  -19.9347    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.0513  -20.7398    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   15.8708  -20.8232    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.2032  -20.0697    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.3001  -18.2736    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   17.0169  -18.6839    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.0166  -19.5072    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.7325  -19.9174    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.4471  -19.5018    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.4412  -18.6717    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.7249  -18.2653    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.1643  -19.9109    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   19.8774  -19.4944    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.5946  -19.9037    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   19.8731  -18.6687    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   21.3077  -19.4871    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.0229  -19.8982    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.7356  -19.4824    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.2999  -18.6649    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.0095  -18.2466    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.7298  -18.6548    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.4412  -18.2350    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.4335  -17.4075    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.7085  -17.0013    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.0001  -17.4233    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.1560  -18.6385    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   24.1618  -19.4652    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.8766  -19.8713    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.5904  -19.4553    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   25.5847  -18.6286    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.8652  -18.2179    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.3078  -19.8643    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  6  1  0
  5  3  1  0
  3  4  2  0
  4  1  1  0
  5  6  2  0
  6  7  1  0
  7  8  1  0
  8  9  2  0
  9  5  1  0
  3 10  1  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 16 11  1  0
 14 17  1  0
 17 18  1  0
 18 19  1  0
 18 20  2  0
 19 21  1  0
 21 22  2  0
 22 23  1  0
 23 26  2  0
 25 24  2  0
 24 21  1  0
 25 26  1  0
 26 27  1  0
 27 28  2  0
 28 29  1  0
 29 30  2  0
 30 25  1  0
 31 32  1  0
 31 36  1  0
 32 33  1  0
 33 34  1  0
 34 35  1  0
 35 36  1  0
 27 31  1  0
 34 37  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4095421

    ---

Associated Targets(Human)

MAP3K7 Tchem Mitogen-activated protein kinase kinase kinase 7 (1167 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 492.58Molecular Weight (Monoisotopic): 492.2274AlogP: 5.90#Rotatable Bonds: 5
Polar Surface Area: 85.52Molecular Species: NEUTRALHBA: 5HBD: 3
#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): 3#RO5 Violations (Lipinski): 1
CX Acidic pKa: 11.58CX Basic pKa: 8.00CX LogP: 4.81CX LogD: 4.11
Aromatic Rings: 5Heavy Atoms: 37QED Weighted: 0.28Np Likeness Score: -1.15

References

1. Miura T, Matsuo A, Muraoka T, Ide M, Morikami K, Kamikawa T, Nishihara M, Kashiwagi H..  (2017)  Identification of a selective inhibitor of transforming growth factor β-activated kinase 1 by biosensor-based screening of focused libraries.,  27  (4): [PMID:28109791] [10.1016/j.bmcl.2016.12.064]

Source