The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-(4-((1r,4r)-4-(4-amino-5-(4-phenoxyphenyl)-7H-pyrrolo[2,3-d]pyrimidin-7-yl)cyclohexyl)piperazin-1-yl)ethanol ID: ALA4095434
PubChem CID: 9806451
Max Phase: Preclinical
Molecular Formula: C30H36N6O2
Molecular Weight: 512.66
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: Nc1ncnc2c1c(-c1ccc(Oc3ccccc3)cc1)cn2[C@H]1CC[C@H](N2CCN(CCO)CC2)CC1
Standard InChI: InChI=1S/C30H36N6O2/c31-29-28-27(22-6-12-26(13-7-22)38-25-4-2-1-3-5-25)20-36(30(28)33-21-32-29)24-10-8-23(9-11-24)35-16-14-34(15-17-35)18-19-37/h1-7,12-13,20-21,23-24,37H,8-11,14-19H2,(H2,31,32,33)/t23-,24-
Standard InChI Key: SJXGAPIUFWMIOV-RQNOJGIXSA-N
Molfile:
RDKit 2D
38 43 0 0 0 0 0 0 0 0999 V2000
8.3934 -6.6861 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.3922 -7.5097 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1003 -7.9187 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.0985 -6.2731 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8112 -6.6825 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8161 -7.5098 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6046 -7.7596 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.0887 -7.0866 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5967 -6.4236 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8488 -5.6408 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6505 -5.4676 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8986 -4.6856 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.3438 -4.0806 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5378 -4.2587 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2935 -5.0404 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8635 -8.5372 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3140 -9.1512 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5681 -9.9282 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.3720 -10.0977 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9215 -9.4837 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6671 -8.7002 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6295 -10.8730 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.5907 -3.2975 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.3929 -3.1177 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9467 -3.7258 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.7482 -3.5507 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.9958 -2.7668 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.4399 -2.1580 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6404 -2.3404 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0960 -5.4518 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.0810 -11.4778 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.3314 -12.2503 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.1295 -12.4207 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.6769 -11.8122 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.4262 -11.0333 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.3816 -13.2022 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8345 -13.8133 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.0866 -14.5947 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
6 7 1 0
7 8 1 0
8 9 2 0
9 5 1 0
9 10 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 10 1 0
16 17 1 0
16 21 1 0
17 18 1 0
18 19 1 0
19 20 1 0
20 21 1 0
16 7 1 1
19 22 1 6
13 23 1 0
23 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 24 1 0
4 30 1 0
22 31 1 0
22 35 1 0
31 32 1 0
32 33 1 0
33 34 1 0
34 35 1 0
33 36 1 0
36 37 1 0
37 38 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 512.66Molecular Weight (Monoisotopic): 512.2900AlogP: 4.57#Rotatable Bonds: 7Polar Surface Area: 92.67Molecular Species: BASEHBA: 8HBD: 2#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): 3#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 8.71CX LogP: 3.93CX LogD: 2.58Aromatic Rings: 4Heavy Atoms: 38QED Weighted: 0.37Np Likeness Score: -0.67
References 1. Yuki H, Kikuzato K, Koda Y, Mikuni J, Tomabechi Y, Kukimoto-Niino M, Tanaka A, Shirai F, Shirouzu M, Koyama H, Honma T.. (2017) Activity cliff for 7-substituted pyrrolo-pyrimidine inhibitors of HCK explained in terms of predicted basicity of the amine nitrogen., 25 (16): [PMID:28662963 ] [10.1016/j.bmc.2017.05.053 ]