2-(4-((1r,4r)-4-(4-amino-5-(4-phenoxyphenyl)-7H-pyrrolo[2,3-d]pyrimidin-7-yl)cyclohexyl)piperazin-1-yl)ethanol

ID: ALA4095434

PubChem CID: 9806451

Max Phase: Preclinical

Molecular Formula: C30H36N6O2

Molecular Weight: 512.66

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Nc1ncnc2c1c(-c1ccc(Oc3ccccc3)cc1)cn2[C@H]1CC[C@H](N2CCN(CCO)CC2)CC1

Standard InChI:  InChI=1S/C30H36N6O2/c31-29-28-27(22-6-12-26(13-7-22)38-25-4-2-1-3-5-25)20-36(30(28)33-21-32-29)24-10-8-23(9-11-24)35-16-14-34(15-17-35)18-19-37/h1-7,12-13,20-21,23-24,37H,8-11,14-19H2,(H2,31,32,33)/t23-,24-

Standard InChI Key:  SJXGAPIUFWMIOV-RQNOJGIXSA-N

Molfile:  

     RDKit          2D

 38 43  0  0  0  0  0  0  0  0999 V2000
    8.3934   -6.6861    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.3922   -7.5097    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1003   -7.9187    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.0985   -6.2731    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8112   -6.6825    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8161   -7.5098    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.6046   -7.7596    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.0887   -7.0866    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.5967   -6.4236    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8488   -5.6408    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.6505   -5.4676    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.8986   -4.6856    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.3438   -4.0806    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.5378   -4.2587    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.2935   -5.0404    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8635   -8.5372    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3140   -9.1512    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.5681   -9.9282    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.3720  -10.0977    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.9215   -9.4837    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.6671   -8.7002    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.6295  -10.8730    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.5907   -3.2975    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.3929   -3.1177    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.9467   -3.7258    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.7482   -3.5507    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.9958   -2.7668    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.4399   -2.1580    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.6404   -2.3404    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0960   -5.4518    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.0810  -11.4778    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.3314  -12.2503    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1295  -12.4207    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   12.6769  -11.8122    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.4262  -11.0333    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.3816  -13.2022    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.8345  -13.8133    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.0866  -14.5947    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  8  9  2  0
  9  5  1  0
  9 10  1  0
 10 11  2  0
 11 12  1  0
 12 13  2  0
 13 14  1  0
 14 15  2  0
 15 10  1  0
 16 17  1  0
 16 21  1  0
 17 18  1  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 16  7  1  1
 19 22  1  6
 13 23  1  0
 23 24  1  0
 24 25  2  0
 25 26  1  0
 26 27  2  0
 27 28  1  0
 28 29  2  0
 29 24  1  0
  4 30  1  0
 22 31  1  0
 22 35  1  0
 31 32  1  0
 32 33  1  0
 33 34  1  0
 34 35  1  0
 33 36  1  0
 36 37  1  0
 37 38  1  0
M  END

Associated Targets(Human)

HCK Tclin Tyrosine-protein kinase HCK (2743 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 512.66Molecular Weight (Monoisotopic): 512.2900AlogP: 4.57#Rotatable Bonds: 7
Polar Surface Area: 92.67Molecular Species: BASEHBA: 8HBD: 2
#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): 3#RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 8.71CX LogP: 3.93CX LogD: 2.58
Aromatic Rings: 4Heavy Atoms: 38QED Weighted: 0.37Np Likeness Score: -0.67

References

1. Yuki H, Kikuzato K, Koda Y, Mikuni J, Tomabechi Y, Kukimoto-Niino M, Tanaka A, Shirai F, Shirouzu M, Koyama H, Honma T..  (2017)  Activity cliff for 7-substituted pyrrolo-pyrimidine inhibitors of HCK explained in terms of predicted basicity of the amine nitrogen.,  25  (16): [PMID:28662963] [10.1016/j.bmc.2017.05.053]

Source