The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
1-(4-Chloro-3-(trifluoromethyl)phenyl)-3-(3-fluoro-4-((6-(methylamino)pyrimidin-4-yl)oxy)phenyl)thiourea ID: ALA4095456
PubChem CID: 137653362
Max Phase: Preclinical
Molecular Formula: C19H14ClF4N5OS
Molecular Weight: 471.87
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CNc1cc(Oc2ccc(NC(=S)Nc3ccc(Cl)c(C(F)(F)F)c3)cc2F)ncn1
Standard InChI: InChI=1S/C19H14ClF4N5OS/c1-25-16-8-17(27-9-26-16)30-15-5-3-11(7-14(15)21)29-18(31)28-10-2-4-13(20)12(6-10)19(22,23)24/h2-9H,1H3,(H,25,26,27)(H2,28,29,31)
Standard InChI Key: AEWLPODVJHBAPQ-UHFFFAOYSA-N
Molfile:
RDKit 2D
31 33 0 0 0 0 0 0 0 0999 V2000
33.5034 -14.6516 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.5023 -15.4712 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.2103 -15.8801 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.9200 -15.4707 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.9172 -14.6480 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.2085 -14.2428 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.7942 -15.8792 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
32.0869 -15.4700 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.3788 -15.8781 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
32.0875 -14.6528 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
30.6714 -15.4689 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.6769 -14.6507 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.9703 -14.2417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.2613 -14.6497 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.2633 -15.4712 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.9704 -15.8765 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.6233 -14.2368 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
36.3326 -14.6427 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.3323 -15.4575 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
37.0407 -15.8634 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.7479 -15.4521 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
37.7421 -14.6307 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.0332 -14.2285 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.4468 -14.2169 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
39.1575 -14.6204 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.5534 -14.2415 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
29.9713 -13.4245 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.6796 -13.0168 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
29.2642 -13.0150 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
29.9637 -12.6046 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
34.2061 -13.4256 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
2 7 1 0
7 8 1 0
8 9 1 0
8 10 2 0
9 11 1 0
11 12 2 0
12 13 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 11 1 0
5 17 1 0
17 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 18 1 0
22 24 1 0
24 25 1 0
14 26 1 0
13 27 1 0
27 28 1 0
27 29 1 0
27 30 1 0
6 31 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 471.87Molecular Weight (Monoisotopic): 471.0544AlogP: 5.93#Rotatable Bonds: 5Polar Surface Area: 71.10Molecular Species: NEUTRALHBA: 5HBD: 3#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): 3#RO5 Violations (Lipinski): 1CX Acidic pKa: 12.57CX Basic pKa: 4.71CX LogP: 5.87CX LogD: 5.87Aromatic Rings: 3Heavy Atoms: 31QED Weighted: 0.31Np Likeness Score: -1.94
References 1. Chen Y, Zheng Y, Jiang Q, Qin F, Zhang Y, Fu L, He G.. (2017) Integrated bioinformatics, computational and experimental methods to discover novel Raf/extracellular-signal regulated kinase (ERK) dual inhibitors against breast cancer cells., 127 [PMID:27839788 ] [10.1016/j.ejmech.2016.11.009 ]