The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-Methyl-2-oxo-2H-chromene-7,8-diyl bis(octane-1-sulfonate) ID: ALA4095459
PubChem CID: 137653596
Max Phase: Preclinical
Molecular Formula: C26H40O8S2
Molecular Weight: 544.73
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCCCCCCCS(=O)(=O)Oc1ccc2c(C)cc(=O)oc2c1OS(=O)(=O)CCCCCCCC
Standard InChI: InChI=1S/C26H40O8S2/c1-4-6-8-10-12-14-18-35(28,29)33-23-17-16-22-21(3)20-24(27)32-25(22)26(23)34-36(30,31)19-15-13-11-9-7-5-2/h16-17,20H,4-15,18-19H2,1-3H3
Standard InChI Key: LAVAXGPTSBTVAF-UHFFFAOYSA-N
Molfile:
RDKit 2D
36 37 0 0 0 0 0 0 0 0999 V2000
16.1498 -4.0406 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.9670 -4.0447 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
16.5620 -3.3349 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.1387 -1.7004 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.5514 -2.4103 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
15.9598 -1.6979 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.9697 -1.5931 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.9686 -2.4126 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.6766 -2.8216 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.6749 -1.1842 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.3835 -1.5895 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.3868 -2.4101 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.0953 -2.8153 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.8049 -2.4043 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.8016 -1.5837 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.0886 -1.1740 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.0841 -0.3568 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.5137 -2.8110 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.2606 -2.8206 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.8452 -2.8195 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.6772 -3.6388 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.9703 -4.8650 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1368 -2.4120 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.4297 -2.8217 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.4310 -3.6389 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.7239 -4.0486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.7252 -4.8658 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.0182 -5.2755 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.0194 -6.0927 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.2642 -5.2764 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.2674 -6.0936 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.5613 -6.5050 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.5646 -7.3222 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.8585 -7.7336 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.8617 -8.5507 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1556 -8.9621 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
5 4 2 0
6 5 2 0
7 8 2 0
8 9 1 0
9 12 2 0
11 10 2 0
10 7 1 0
11 12 1 0
11 16 1 0
12 13 1 0
13 14 1 0
14 15 1 0
15 16 2 0
16 17 1 0
14 18 2 0
8 19 1 0
19 5 1 0
5 20 1 0
9 21 1 0
21 2 1 0
2 22 1 0
20 23 1 0
23 24 1 0
24 25 1 0
25 26 1 0
26 27 1 0
27 28 1 0
28 29 1 0
22 30 1 0
30 31 1 0
31 32 1 0
32 33 1 0
33 34 1 0
34 35 1 0
35 36 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 544.73Molecular Weight (Monoisotopic): 544.2165AlogP: 6.24#Rotatable Bonds: 18Polar Surface Area: 116.95Molecular Species: NEUTRALHBA: 8HBD: ┄#RO5 Violations: 2HBA (Lipinski): 8HBD (Lipinski): ┄#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 6.80CX LogD: 6.80Aromatic Rings: 2Heavy Atoms: 36QED Weighted: 0.12Np Likeness Score: 0.13
References 1. Salar U, Khan KM, Iqbal J, Ejaz SA, Hameed A, Al-Rashida M, Perveen S, Tahir MN.. (2017) Coumarin sulfonates: New alkaline phosphatase inhibitors; in vitro and in silico studies., 131 [PMID:28288318 ] [10.1016/j.ejmech.2017.03.003 ]