4-Methyl-2-oxo-2H-chromene-7,8-diyl bis(octane-1-sulfonate)

ID: ALA4095459

PubChem CID: 137653596

Max Phase: Preclinical

Molecular Formula: C26H40O8S2

Molecular Weight: 544.73

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCCCCCCCS(=O)(=O)Oc1ccc2c(C)cc(=O)oc2c1OS(=O)(=O)CCCCCCCC

Standard InChI:  InChI=1S/C26H40O8S2/c1-4-6-8-10-12-14-18-35(28,29)33-23-17-16-22-21(3)20-24(27)32-25(22)26(23)34-36(30,31)19-15-13-11-9-7-5-2/h16-17,20H,4-15,18-19H2,1-3H3

Standard InChI Key:  LAVAXGPTSBTVAF-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 36 37  0  0  0  0  0  0  0  0999 V2000
   16.1498   -4.0406    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.9670   -4.0447    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   16.5620   -3.3349    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.1387   -1.7004    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.5514   -2.4103    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   15.9598   -1.6979    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.9697   -1.5931    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.9686   -2.4126    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.6766   -2.8216    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.6749   -1.1842    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.3835   -1.5895    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.3868   -2.4101    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.0953   -2.8153    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   19.8049   -2.4043    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.8016   -1.5837    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.0886   -1.1740    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.0841   -0.3568    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.5137   -2.8110    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.2606   -2.8206    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.8452   -2.8195    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.6772   -3.6388    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.9703   -4.8650    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.1368   -2.4120    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.4297   -2.8217    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.4310   -3.6389    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.7239   -4.0486    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.7252   -4.8658    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.0182   -5.2755    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.0194   -6.0927    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.2642   -5.2764    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.2674   -6.0936    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.5613   -6.5050    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.5646   -7.3222    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.8585   -7.7336    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.8617   -8.5507    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.1556   -8.9621    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  2  0
  5  4  2  0
  6  5  2  0
  7  8  2  0
  8  9  1  0
  9 12  2  0
 11 10  2  0
 10  7  1  0
 11 12  1  0
 11 16  1  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 15 16  2  0
 16 17  1  0
 14 18  2  0
  8 19  1  0
 19  5  1  0
  5 20  1  0
  9 21  1  0
 21  2  1  0
  2 22  1  0
 20 23  1  0
 23 24  1  0
 24 25  1  0
 25 26  1  0
 26 27  1  0
 27 28  1  0
 28 29  1  0
 22 30  1  0
 30 31  1  0
 31 32  1  0
 32 33  1  0
 33 34  1  0
 34 35  1  0
 35 36  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4095459

    ---

Associated Targets(Human)

ALPL Tchem Alkaline phosphatase, tissue-nonspecific isozyme (1551 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
ALPI Tchem Intestinal alkaline phosphatase (724 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 544.73Molecular Weight (Monoisotopic): 544.2165AlogP: 6.24#Rotatable Bonds: 18
Polar Surface Area: 116.95Molecular Species: NEUTRALHBA: 8HBD:
#RO5 Violations: 2HBA (Lipinski): 8HBD (Lipinski): #RO5 Violations (Lipinski): 2
CX Acidic pKa: CX Basic pKa: CX LogP: 6.80CX LogD: 6.80
Aromatic Rings: 2Heavy Atoms: 36QED Weighted: 0.12Np Likeness Score: 0.13

References

1. Salar U, Khan KM, Iqbal J, Ejaz SA, Hameed A, Al-Rashida M, Perveen S, Tahir MN..  (2017)  Coumarin sulfonates: New alkaline phosphatase inhibitors; in vitro and in silico studies.,  131  [PMID:28288318] [10.1016/j.ejmech.2017.03.003]

Source