The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
1-(3,5-Bis(trifluoromethyl)phenyl)-3-((1,4-trans)-4-(4-(trifluoromethyl)phenoxy)cyclohexyl)urea ID: ALA4095536
PubChem CID: 117954770
Max Phase: Preclinical
Molecular Formula: C22H19F9N2O2
Molecular Weight: 514.39
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: O=C(Nc1cc(C(F)(F)F)cc(C(F)(F)F)c1)N[C@H]1CC[C@H](Oc2ccc(C(F)(F)F)cc2)CC1
Standard InChI: InChI=1S/C22H19F9N2O2/c23-20(24,25)12-1-5-17(6-2-12)35-18-7-3-15(4-8-18)32-19(34)33-16-10-13(21(26,27)28)9-14(11-16)22(29,30)31/h1-2,5-6,9-11,15,18H,3-4,7-8H2,(H2,32,33,34)/t15-,18-
Standard InChI Key: MGYQQVMSZRZRGX-RZDIXWSQSA-N
Molfile:
RDKit 2D
35 37 0 0 0 0 0 0 0 0999 V2000
23.2308 -19.8767 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.2296 -20.6962 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.9377 -21.1052 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.6473 -20.6958 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.6445 -19.8731 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.9359 -19.4678 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.1526 -19.8973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.1514 -20.7169 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.8595 -21.1258 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.5691 -20.7164 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.5663 -19.8937 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.8577 -19.4885 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.2725 -19.4825 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.9817 -19.8884 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.6879 -19.4771 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.9848 -20.7056 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
20.3971 -19.8831 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.3978 -20.6988 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.1030 -21.1046 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.8116 -20.6969 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.8105 -19.8787 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.1008 -19.4684 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.5193 -21.1055 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
25.3506 -19.4618 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.0599 -19.8678 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
25.3476 -18.6447 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
26.0552 -19.0472 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
16.8593 -21.9430 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.1514 -22.3514 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
17.5669 -22.3518 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
16.8515 -22.7575 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
15.4447 -19.4889 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.4446 -18.6717 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
14.7371 -19.8977 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
14.7342 -19.0802 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
7 8 2 0
8 9 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 7 1 0
11 13 1 0
13 14 1 0
14 15 1 0
14 16 2 0
17 15 1 6
17 18 1 0
17 22 1 0
18 19 1 0
19 20 1 0
20 21 1 0
21 22 1 0
20 23 1 1
23 2 1 0
5 24 1 0
24 25 1 0
24 26 1 0
24 27 1 0
9 28 1 0
28 29 1 0
28 30 1 0
28 31 1 0
7 32 1 0
32 33 1 0
32 34 1 0
32 35 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 514.39Molecular Weight (Monoisotopic): 514.1303AlogP: 7.25#Rotatable Bonds: 4Polar Surface Area: 50.36Molecular Species: NEUTRALHBA: 2HBD: 2#RO5 Violations: 2HBA (Lipinski): 4HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: 13.06CX Basic pKa: ┄CX LogP: 6.48CX LogD: 6.48Aromatic Rings: 2Heavy Atoms: 35QED Weighted: 0.42Np Likeness Score: -0.96
References 1. Yefidoff-Freedman R, Fan J, Yan L, Zhang Q, Dos Santos GRR, Rana S, Contreras JI, Sahoo R, Wan D, Young J, Dias Teixeira KL, Morisseau C, Halperin J, Hammock B, Natarajan A, Wang P, Chorev M, Aktas BH.. (2017) Development of 1-((1,4-trans)-4-Aryloxycyclohexyl)-3-arylurea Activators of Heme-Regulated Inhibitor as Selective Activators of the Eukaryotic Initiation Factor 2 Alpha (eIF2α) Phosphorylation Arm of the Integrated Endoplasmic Reticulum Stress Response., 60 (13): [PMID:28590739 ] [10.1021/acs.jmedchem.7b00059 ]