9-((1-(4-methoxyphenyl)-1H-1,2,3-triazol-4-yl)methoxy)-7H-furo[3,2-g]chromen-7-one

ID: ALA4095538

PubChem CID: 137654790

Max Phase: Preclinical

Molecular Formula: C21H15N3O5

Molecular Weight: 389.37

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COc1ccc(-n2cc(COc3c4occc4cc4ccc(=O)oc34)nn2)cc1

Standard InChI:  InChI=1S/C21H15N3O5/c1-26-17-5-3-16(4-6-17)24-11-15(22-23-24)12-28-21-19-14(8-9-27-19)10-13-2-7-18(25)29-20(13)21/h2-11H,12H2,1H3

Standard InChI Key:  UOGJLSXYXYMUOG-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 29 33  0  0  0  0  0  0  0  0999 V2000
   32.5018   -2.4652    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.7193   -2.2152    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.2422   -2.8728    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.7193   -3.5386    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   32.5018   -3.2843    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.2096   -3.6919    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.2096   -4.5110    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   33.9174   -4.9225    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.9174   -5.7416    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.2556   -6.2230    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   33.5057   -7.0014    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   34.3248   -7.0014    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   34.8062   -7.6631    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.6230   -7.5737    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.1043   -8.2396    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.7687   -8.9865    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.9561   -9.0716    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.4748   -8.4099    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.1804   -9.6943    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   36.9995   -9.6943    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.5791   -6.2230    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.9173   -3.2843    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.6251   -3.6919    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   35.3370   -3.2843    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.0447   -3.6919    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   35.3370   -2.4652    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.6251   -2.0578    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.9173   -2.4652    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.2096   -2.0578    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  3  2  2  0
  4  3  1  0
  5  4  1  0
  1  5  1  0
  5  6  2  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
 10  9  1  0
 11 10  2  0
 12 11  1  0
 12 13  1  0
 14 13  1  0
 15 14  2  0
 16 15  1  0
 17 16  2  0
 18 17  1  0
 13 18  2  0
 16 19  1  0
 19 20  1  0
 21 12  1  0
 21  9  2  0
  6 22  1  0
 22 23  1  0
 23 24  1  0
 24 25  2  0
 24 26  1  0
 26 27  2  0
 28 27  1  0
 22 28  2  0
 28 29  1  0
 29  1  2  0
M  END

Alternative Forms

  1. Parent:

    ALA4095538

    ---

Associated Targets(Human)

AGS (1999 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
L02 (4864 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 389.37Molecular Weight (Monoisotopic): 389.1012AlogP: 3.71#Rotatable Bonds: 5
Polar Surface Area: 92.52Molecular Species: NEUTRALHBA: 8HBD:
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: CX LogP: 3.14CX LogD: 3.14
Aromatic Rings: 5Heavy Atoms: 29QED Weighted: 0.42Np Likeness Score: -0.42

References

1. Shen QK, Liu CF, Zhang HJ, Tian YS, Quan ZS..  (2017)  Design and synthesis of new triazoles linked to xanthotoxin for potent and highly selective anti-gastric cancer agents.,  27  (21): [PMID:28947149] [10.1016/j.bmcl.2017.09.040]

Source