5-(4-fluorophenyl)-3-(3-((2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)tetrahydro-2H-pyran-2-yloxy)phenyl)oxazolidin-2-one

ID: ALA4095615

PubChem CID: 137652904

Max Phase: Preclinical

Molecular Formula: C21H22FNO8

Molecular Weight: 435.40

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  O=C1OC(c2ccc(F)cc2)CN1c1cccc(O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)c1

Standard InChI:  InChI=1S/C21H22FNO8/c22-12-6-4-11(5-7-12)15-9-23(21(28)31-15)13-2-1-3-14(8-13)29-20-19(27)18(26)17(25)16(10-24)30-20/h1-8,15-20,24-27H,9-10H2/t15?,16-,17-,18+,19-,20-/m1/s1

Standard InChI Key:  ZKYYBLDNDWMVMH-FJVJWUHISA-N

Molfile:  

     RDKit          2D

 31 34  0  0  0  0  0  0  0  0999 V2000
   13.7788   -1.9737    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.4808   -0.4923    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.1154   -0.3597    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   17.0444   -1.7069    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.0625   -2.5820    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   17.1318   -2.9771    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.5915   -1.9076    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.9425   -1.1669    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.7645   -1.1005    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.2261   -1.7750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.8752   -2.5157    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.3424   -3.1884    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.7714   -4.8247    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.3116   -6.0687    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.9924   -5.6166    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.9556   -4.7940    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   13.6736   -5.5600    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.8865   -5.7800    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.5044   -4.1185    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.8685   -3.3856    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.4161   -2.7060    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.5997   -2.7580    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.2378   -3.4954    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.6923   -4.1720    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.7563   -5.9022    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.8903   -6.7094    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.6550   -6.9954    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.2863   -6.4751    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.1479   -5.6655    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.3832   -5.3832    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.0523   -6.7600    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  6 12  1  0
 11  5  1  0
  5  7  1  0
  7  8  1  0
  8  9  1  0
  9 10  1  0
 10 11  1  0
 11 12  1  1
  7  1  1  1
  8  2  1  6
  9  3  1  1
 10  4  1  6
 14 15  1  0
 15 13  1  0
 13 16  1  0
 16 17  1  0
 17 14  1  0
 17 18  2  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
 24 19  1  0
 16 19  1  0
 25 26  2  0
 26 27  1  0
 27 28  2  0
 28 29  1  0
 29 30  2  0
 30 25  1  0
 15 25  1  0
 28 31  1  0
 21  1  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4095615

    ---

Associated Targets(non-human)

Liver (8163 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 435.40Molecular Weight (Monoisotopic): 435.1329AlogP: 0.70#Rotatable Bonds: 5
Polar Surface Area: 128.92Molecular Species: NEUTRALHBA: 8HBD: 4
#RO5 Violations: HBA (Lipinski): 9HBD (Lipinski): 4#RO5 Violations (Lipinski):
CX Acidic pKa: 12.20CX Basic pKa: CX LogP: 0.88CX LogD: 0.88
Aromatic Rings: 2Heavy Atoms: 31QED Weighted: 0.54Np Likeness Score: 0.37

References

1. Fujimoto J, Okamoto R, Noguchi N, Hara R, Masada S, Kawamoto T, Nagase H, Tamura YO, Imanishi M, Takagahara S, Kubo K, Tohyama K, Iida K, Andou T, Miyahisa I, Matsui J, Hayashi R, Maekawa T, Matsunaga N..  (2017)  Discovery of 3,5-Diphenyl-4-methyl-1,3-oxazolidin-2-ones as Novel, Potent, and Orally Available Δ-5 Desaturase (D5D) Inhibitors.,  60  (21): [PMID:29023121] [10.1021/acs.jmedchem.7b01210]

Source