2-(2-Methyl-5-nitro-1H-imidazol-1-yl)ethyl benzo[d]thiazole-6-carboxylate

ID: ALA4095662

PubChem CID: 137654797

Max Phase: Preclinical

Molecular Formula: C14H12N4O4S

Molecular Weight: 332.34

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Cc1ncc([N+](=O)[O-])n1CCOC(=O)c1ccc2ncsc2c1

Standard InChI:  InChI=1S/C14H12N4O4S/c1-9-15-7-13(18(20)21)17(9)4-5-22-14(19)10-2-3-11-12(6-10)23-8-16-11/h2-3,6-8H,4-5H2,1H3

Standard InChI Key:  NFFXZJOIRFGIGQ-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 23 25  0  0  0  0  0  0  0  0999 V2000
   20.3007  -18.1764    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   20.9552  -17.6871    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.6938  -16.9127    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.8742  -16.9236    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   19.6353  -17.7042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.3108  -18.9936    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.7376  -17.9297    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   22.3380  -17.3753    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   21.9175  -18.7268    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   21.0236  -19.3934    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.0337  -20.2105    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   21.7464  -20.6103    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.7565  -21.4274    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.4490  -20.1929    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   18.8617  -17.9676    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.0532  -21.8398    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.0630  -22.6561    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.4679  -21.8200    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.4811  -22.6350    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.7783  -23.0581    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.9635  -23.8573    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   22.7808  -23.9281    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.1006  -23.1727    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  3  4  1  0
  4  5  2  0
  5  1  1  0
  1  6  1  0
  7  8  2  0
  7  9  1  0
  2  7  1  0
  6 10  1  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
 12 14  2  0
  5 15  1  0
 13 16  2  0
 16 17  1  0
 17 20  2  0
 19 18  2  0
 18 13  1  0
 19 20  1  0
 20 21  1  0
 21 22  2  0
 22 23  1  0
 23 19  1  0
M  CHG  2   7   1   9  -1
M  END

Alternative Forms

  1. Parent:

    ALA4095662

    ---

Associated Targets(non-human)

GUSB Beta-glucuronidase (291 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 332.34Molecular Weight (Monoisotopic): 332.0579AlogP: 2.57#Rotatable Bonds: 5
Polar Surface Area: 100.15Molecular Species: NEUTRALHBA: 8HBD:
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 3.28CX LogP: 2.18CX LogD: 2.18
Aromatic Rings: 3Heavy Atoms: 23QED Weighted: 0.40Np Likeness Score: -1.97

References

1. Salar U, Khan KM, Taha M, Ismail NH, Ali B, Qurat-Ul-Ain, Perveen S, Ghufran M, Wadood A..  (2017)  Biology-oriented drug synthesis (BIODS): In vitro β-glucuronidase inhibitory and in silico studies on 2-(2-methyl-5-nitro-1H-imidazol-1-yl)ethyl aryl carboxylate derivatives.,  125  [PMID:27886546] [10.1016/j.ejmech.2016.11.031]

Source