(S)-5-(furo[3,2-b]pyridin-2-yl)-5-((6-methoxy-1-oxoisoindolin-2-yl)methyl)-3-methylimidazolidine-2,4-dione

ID: ALA4095754

PubChem CID: 46190060

Max Phase: Preclinical

Molecular Formula: C21H18N4O5

Molecular Weight: 406.40

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COc1ccc2c(c1)C(=O)N(C[C@@]1(c3cc4ncccc4o3)NC(=O)N(C)C1=O)C2

Standard InChI:  InChI=1S/C21H18N4O5/c1-24-19(27)21(23-20(24)28,17-9-15-16(30-17)4-3-7-22-15)11-25-10-12-5-6-13(29-2)8-14(12)18(25)26/h3-9H,10-11H2,1-2H3,(H,23,28)/t21-/m0/s1

Standard InChI Key:  MGFSINOYNGKQMT-NRFANRHFSA-N

Molfile:  

     RDKit          2D

 30 34  0  0  0  0  0  0  0  0999 V2000
   19.1200   -4.2865    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.3630   -5.0729    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   20.1793   -5.0853    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.4455   -4.3090    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.7911   -3.8066    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   18.3455   -4.0182    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   20.6465   -5.7539    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   21.2286   -4.0722    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.6329   -4.4730    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.8297   -4.6351    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   21.7335   -5.4416    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.4724   -5.7868    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.7104   -6.5731    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.5103   -6.7593    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.0705   -6.1601    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.8281   -5.3751    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.0282   -5.1889    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.9782   -3.7341    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   24.8701   -6.3434    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   25.1068   -7.1279    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.4385   -3.4901    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.0975   -3.0019    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   19.7684   -3.0092    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.0167   -2.2282    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.8395   -2.2255    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.2438   -1.5155    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.8311   -0.8033    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.0077   -0.8121    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.6049   -1.5229    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   18.9464   -5.7759    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  1  5  1  0
  1  6  2  0
  3  7  2  0
  9 10  1  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 16 17  1  0
  9 17  1  0
 12 17  2  0
  9 18  2  0
 19 20  1  0
 15 19  1  0
  8 10  1  0
  4  8  1  6
  4 21  1  0
 21 22  1  0
 22 25  1  0
 24 23  1  0
 23 21  2  0
 24 25  2  0
 25 26  1  0
 26 27  2  0
 27 28  1  0
 28 29  2  0
 29 24  1  0
  2 30  1  0
M  END

Associated Targets(Human)

ADAM17 Tchem ADAM17 (3550 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

Rattus norvegicus (775804 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 406.40Molecular Weight (Monoisotopic): 406.1277AlogP: 1.87#Rotatable Bonds: 4
Polar Surface Area: 104.98Molecular Species: NEUTRALHBA: 6HBD: 1
#RO5 Violations: HBA (Lipinski): 9HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 9.94CX Basic pKa: 2.89CX LogP: 0.73CX LogD: 0.73
Aromatic Rings: 3Heavy Atoms: 30QED Weighted: 0.66Np Likeness Score: -0.40

References

1. Tong L, Kim SH, Chen L, Kosinski A, Shankar BB, Girijavallabhan V, Yang DY, Yu W, Zhou G, Shih NY, Chen S, Hu M, Lundell D, Niu X, Umland S, Kozlowski JA..  (2017)  Development of a prodrug of hydantoin based TACE inhibitor.,  27  (16): [PMID:28711352] [10.1016/j.bmcl.2017.07.007]

Source