The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
3-{2,4-Dioxo-1-[(4-sulfamoylphenyl)methyl]-1,2,3,4-tetrahydropyrimidin-5-yl}-N-[(4-fluoro-3-methoxyphenyl)-methyl]prop-2-ynamide ID: ALA4095780
PubChem CID: 137654086
Max Phase: Preclinical
Molecular Formula: C22H19FN4O6S
Molecular Weight: 486.48
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc(CNC(=O)C#Cc2cn(Cc3ccc(S(N)(=O)=O)cc3)c(=O)[nH]c2=O)ccc1F
Standard InChI: InChI=1S/C22H19FN4O6S/c1-33-19-10-15(4-8-18(19)23)11-25-20(28)9-5-16-13-27(22(30)26-21(16)29)12-14-2-6-17(7-3-14)34(24,31)32/h2-4,6-8,10,13H,11-12H2,1H3,(H,25,28)(H2,24,31,32)(H,26,29,30)
Standard InChI Key: FTDANXPNKJENKV-UHFFFAOYSA-N
Molfile:
RDKit 2D
34 36 0 0 0 0 0 0 0 0999 V2000
33.8928 -1.9357 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
34.3055 -2.6456 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
34.7139 -1.9332 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
37.8436 -3.0430 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.8436 -3.8663 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
38.5557 -4.2706 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.2574 -3.8663 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.2574 -3.0430 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.5557 -2.6282 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
39.9682 -4.2743 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.6787 -4.6904 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.1302 -2.6334 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
39.9709 -2.6334 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
41.3927 -5.0998 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.3892 -5.9190 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
42.1019 -4.6923 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
42.8159 -5.1018 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.5293 -4.6983 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.2347 -5.1127 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.9432 -4.7061 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.9505 -3.8865 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.2362 -3.4718 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.5279 -3.8819 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.2384 -2.6548 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
37.1399 -4.2756 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.4287 -3.8679 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.4298 -3.0550 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.7240 -2.6475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.0147 -3.0569 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.0179 -3.8803 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.7287 -4.2823 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.9472 -2.2481 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
45.6605 -3.4819 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
33.5993 -3.0596 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
4 5 1 0
4 9 1 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 1 0
7 10 1 0
10 11 3 0
4 12 2 0
8 13 2 0
11 14 1 0
14 15 2 0
14 16 1 0
16 17 1 0
17 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 18 1 0
22 24 1 0
5 25 1 0
25 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 26 1 0
24 32 1 0
21 33 1 0
29 2 1 0
2 34 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 486.48Molecular Weight (Monoisotopic): 486.1009AlogP: 0.05#Rotatable Bonds: 6Polar Surface Area: 153.35Molecular Species: NEUTRALHBA: 7HBD: 3#RO5 Violations: ┄HBA (Lipinski): 10HBD (Lipinski): 4#RO5 Violations (Lipinski): ┄CX Acidic pKa: 9.41CX Basic pKa: ┄CX LogP: 0.89CX LogD: 0.88Aromatic Rings: 3Heavy Atoms: 34QED Weighted: 0.42Np Likeness Score: -1.28
References 1. Senn N, Ott M, Lanz J, Riedl R.. (2017) Targeted Polypharmacology: Discovery of a Highly Potent Non-Hydroxamate Dual Matrix Metalloproteinase (MMP)-10/-13 Inhibitor., 60 (23): [PMID:28953404 ] [10.1021/acs.jmedchem.7b01001 ]