The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
3-acetoxycopalic acid ID: ALA4095841
PubChem CID: 101892773
Max Phase: Preclinical
Molecular Formula: C22H34O4
Molecular Weight: 362.51
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: C=C1CC[C@@H]2C(C)(C)C(OC(C)=O)CC[C@@]2(C)[C@@H]1CC/C(C)=C/C(=O)O
Standard InChI: InChI=1S/C22H34O4/c1-14(13-20(24)25)7-9-17-15(2)8-10-18-21(4,5)19(26-16(3)23)11-12-22(17,18)6/h13,17-19H,2,7-12H2,1,3-6H3,(H,24,25)/b14-13+/t17-,18-,19?,22+/m1/s1
Standard InChI Key: OMNJRQNCWHCCBZ-AVIKLCGHSA-N
Molfile:
RDKit 2D
27 28 0 0 0 0 0 0 0 0999 V2000
16.6421 -7.2502 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.2879 -6.4501 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.8751 -7.1601 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.6259 -5.1951 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.5902 -6.0193 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.3595 -4.8055 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.0527 -5.2567 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.0136 -6.0808 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.7038 -6.5202 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.4376 -6.1485 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.4768 -5.3244 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.7822 -4.8719 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.8202 -4.0478 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.5530 -3.6729 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.5910 -2.8487 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.3238 -2.4654 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.8964 -2.3996 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.9343 -1.5754 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.2355 -1.1346 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.6671 -1.2004 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.2104 -4.9429 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.0463 -4.4335 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.1046 -6.9085 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
14.8611 -6.4056 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.1621 -5.9673 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.4331 -6.3536 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1922 -5.1429 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 2 1 0
4 5 1 0
4 6 1 0
5 2 1 0
2 8 1 0
7 6 1 0
7 8 1 0
7 12 1 0
8 9 1 0
9 10 1 0
10 11 1 0
11 12 1 0
12 13 1 6
13 14 1 0
14 15 1 0
15 16 1 0
15 17 2 0
17 18 1 0
18 19 2 0
18 20 1 0
11 21 2 0
7 22 1 6
8 23 1 1
5 24 1 0
24 25 1 0
25 26 1 0
25 27 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 362.51Molecular Weight (Monoisotopic): 362.2457AlogP: 5.14#Rotatable Bonds: 5Polar Surface Area: 63.60Molecular Species: ACIDHBA: 3HBD: 1#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: 4.62CX Basic pKa: ┄CX LogP: 4.69CX LogD: 1.98Aromatic Rings: ┄Heavy Atoms: 26QED Weighted: 0.42Np Likeness Score: 3.01
References 1. Idippily ND, Zheng Q, Gan C, Quamine A, Ashcraft MM, Zhong B, Su B.. (2017) Copalic acid analogs down-regulate androgen receptor and inhibit small chaperone protein., 27 (11): [PMID:28442254 ] [10.1016/j.bmcl.2017.04.046 ]