Octapeptin C4

ID: ALA4095968

PubChem CID: 137655478

Max Phase: Preclinical

Molecular Formula: C51H89N13O10

Molecular Weight: 1044.35

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Bioactivity Summary Target Summary Assay Summary

Names and Identifiers

Canonical SMILES: CCCCCCC[C@@H](O)CC(=O)N[C@H](CCN)C(=O)N[C@H]1CCNC(=O)[C@H](CC(C)C)NC(=O)[C@H](CCN)NC(=O)[C@H](CCN)NC(=O)[C@H](CC(C)C)NC(=O)[C@@H](Cc2ccccc2)NC(=O)[C@H](CCN)NC1=O

Standard InChI: InChI=1S/C51H89N13O10/c1-6-7-8-9-13-16-34(65)30-43(66)57-35(17-22-52)45(68)61-39-21-26-56-44(67)40(27-31(2)3)62-47(70)37(19-24-54)58-46(69)36(18-23-53)60-50(73)41(28-32(4)5)63-51(74)42(29-33-14-11-10-12-15-33)64-48(71)38(20-25-55)59-49(39)72/h10-12,14-15,31-32,34-42,65H,6-9,13,16-30,52-55H2,1-5H3,(H,56,67)(H,57,66)(H,58,69)(H,59,72)(H,60,73)(H,61,68)(H,62,70)(H,63,74)(H,64,71)/t34-,35-,36+,37+,38+,39+,40+,41+,42-/m1/s1

Standard InChI Key: CSZHCBAEEWWDDZ-SDCQBVLXSA-N

Molfile:

     RDKit          2D

 74 75  0  0  0  0  0  0  0  0999 V2000
    9.7479   -4.6143    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.4638   -5.0248    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.1756   -4.6143    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.8916   -5.0248    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.8916   -5.8498    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.1756   -6.2603    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.1756   -7.0853    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.8916   -7.4957    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.8916   -8.3208    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.6033   -8.7312    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   12.6033   -9.5563    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.8916   -9.9709    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.3151   -9.9709    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.0311   -9.5563    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   15.4588   -9.5563    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.4588   -8.7312    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.7429   -8.3208    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   14.7429   -7.4957    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.4588   -7.0853    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.4588   -6.2603    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   16.1705   -5.8498    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.1705   -5.0248    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.4588   -4.6143    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   14.7429   -5.0248    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.0311   -4.6143    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.3151   -5.0248    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   12.6033   -4.6143    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.6033   -3.7893    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.0311   -3.7893    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.7429   -3.3747    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.4590   -3.7919    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.1709   -3.3758    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.1687   -2.5566    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.4565   -2.1419    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.7432   -2.5538    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.7429   -5.8498    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.8866   -4.6143    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.5983   -5.0248    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.3142   -4.6143    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.5983   -5.8498    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.8866   -6.2603    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.1705   -7.4957    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.8866   -7.0853    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.5983   -7.4957    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   14.0311   -7.0853    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.1705   -8.3208    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.8866   -8.7312    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.5983   -8.3208    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   16.1705   -9.9709    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.3151  -10.7959    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.6033  -11.2064    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.6033  -12.0314    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.8916  -10.7959    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.4638   -7.4957    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.7479   -7.0853    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0361   -7.4957    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0361   -8.3208    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.7479   -8.7312    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.7479   -9.5563    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.3201   -7.0853    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.6084   -7.4957    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8924   -7.0853    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1807   -7.4957    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4647   -7.0853    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7529   -7.4957    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0370   -7.0853    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3252   -7.4957    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6092   -7.0853    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8975   -7.4957    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1815   -7.0853    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1807   -8.3208    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.6084   -8.3208    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.7479   -6.2603    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.4638   -5.8498    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  1  0
  4  3  1  1
  5  4  1  0
  6  5  1  0
  7  6  1  0
  8  7  1  0
  9  8  1  0
 10  9  1  0
 11 10  1  0
 11 12  2  0
 13 11  1  0
 13 14  1  0
 15 14  1  0
 16 15  1  0
 17 16  1  0
 18 17  1  0
 19 18  1  0
 20 19  1  0
 21 20  1  0
 22 21  1  0
 23 22  1  0
 24 23  1  0
 25 24  1  0
 26 25  1  0
 27 26  1  0
  4 27  1  0
 27 28  2  0
 25 29  1  6
 29 30  1  0
 30 31  1  0
 31 32  2  0
 32 33  1  0
 33 34  2  0
 34 35  1  0
 35 30  2  0
 24 36  2  0
 22 37  1  1
 37 38  1  0
 38 39  1  0
 38 40  1  0
 21 41  2  0
 19 42  1  1
 42 43  1  0
 43 44  1  0
 18 45  2  0
 16 46  1  1
 46 47  1  0
 47 48  1  0
 15 49  2  0
 13 50  1  1
 50 51  1  0
 51 52  1  0
 51 53  1  0
  7 54  1  6
 54 55  1  0
 55 56  1  0
 56 57  1  1
 57 58  1  0
 58 59  1  0
 56 60  1  0
 60 61  1  0
 61 62  1  0
 62 63  1  0
 63 64  1  0
 64 65  1  0
 65 66  1  0
 66 67  1  0
 67 68  1  0
 68 69  1  0
 69 70  1  0
 63 71  1  6
 61 72  2  0
 55 73  2  0
  6 74  2  0
M  END

Associated Targets(non-human)

Escherichia coli (133304 Activities)

Explore this target

Activity Type	Relation	Activity value	Units	Action Type	Journal	PubMed Id	doi	Assay Aladdin ID

Klebsiella pneumoniae (43867 Activities)

Explore this target

Activity Type	Relation	Activity value	Units	Action Type	Journal	PubMed Id	doi	Assay Aladdin ID

Acinetobacter baumannii (41033 Activities)

Explore this target

Activity Type	Relation	Activity value	Units	Action Type	Journal	PubMed Id	doi	Assay Aladdin ID

Pseudomonas aeruginosa (123386 Activities)

Explore this target

Activity Type	Relation	Activity value	Units	Action Type	Journal	PubMed Id	doi	Assay Aladdin ID

Staphylococcus aureus (210822 Activities)

Explore this target

Activity Type	Relation	Activity value	Units	Action Type	Journal	PubMed Id	doi	Assay Aladdin ID

Natural Product: Yes	Oral: No	Chemical Probe: No	Parenteral: No
Molecule Type: Small molecule	Topical: No	First In Class: No	Black Box: No
Chirality: No	Availability: No	Prodrug: No

Natural Product: Yes

Oral: No

Chemical Probe: No

Parenteral: No

Molecule Type: Small molecule

Topical: No

First In Class: No

Black Box: No

Chirality: No

Availability: No

Prodrug: No

Calculated Properties

Molecular Weight: 1044.35	Molecular Weight (Monoisotopic): 1043.6855	AlogP: ┄	#Rotatable Bonds: ┄
Polar Surface Area: ┄	Molecular Species: ┄	HBA: ┄	HBD: ┄
#RO5 Violations: ┄	HBA (Lipinski): ┄	HBD (Lipinski): ┄	#RO5 Violations (Lipinski): ┄
CX Acidic pKa: ┄	CX Basic pKa: ┄	CX LogP: ┄	CX LogD: ┄
Aromatic Rings: ┄	Heavy Atoms: ┄	QED Weighted: ┄	Np Likeness Score: ┄

References

1. Becker B, Butler MS, Hansford KA, Gallardo-Godoy A, Elliott AG, Huang JX, Edwards DJ, Blaskovich MAT, Cooper MA.. (2017) Synthesis of octapeptin C4 and biological profiling against NDM-1 and polymyxin-resistant bacteria., 27 (11): [PMID:28454673] [10.1016/j.bmcl.2017.04.027]

Octapeptin C4

Names and Identifiers

Alternative Forms

Associated Targets(Human)

Associated Targets(non-human)

Molecule Features

Drug Indications

Mechanisms of Action

Calculated Properties

References

Source