The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(3aS,5aS,8S,9R,9bS)-5a,9-Dimethyl-3-methylene-2-oxododecahydronaphtho[1,2-b]furan-8-yl 3-(Trifluoromethyl)-benzoate ID: ALA4095972
PubChem CID: 137655712
Max Phase: Preclinical
Molecular Formula: C23H25F3O4
Molecular Weight: 422.44
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: C=C1C(=O)O[C@@H]2C3[C@@H](C)C(OC(=O)c4cccc(C(F)(F)F)c4)CC[C@]3(C)CC[C@@H]12
Standard InChI: InChI=1S/C23H25F3O4/c1-12-16-7-9-22(3)10-8-17(13(2)18(22)19(16)30-20(12)27)29-21(28)14-5-4-6-15(11-14)23(24,25)26/h4-6,11,13,16-19H,1,7-10H2,2-3H3/t13-,16-,17?,18?,19-,22-/m0/s1
Standard InChI Key: HNFRQOINAHFFTK-GQFGSLMRSA-N
Molfile:
RDKit 2D
32 35 0 0 0 0 0 0 0 0999 V2000
32.5308 -22.5966 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.5308 -23.4138 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.2361 -23.8182 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.2361 -22.1839 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.9414 -22.5966 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.9379 -23.4138 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.3535 -22.6026 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.6469 -22.1887 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.3500 -23.4198 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.6405 -23.8236 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.8053 -24.6232 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
35.6168 -24.7136 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.9533 -23.9698 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.9341 -21.7794 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.2283 -24.6354 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.8237 -23.8234 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
31.1154 -23.4158 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.4083 -23.8254 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.1142 -22.5986 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
29.7025 -23.4175 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.9959 -23.8264 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.9966 -24.6445 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.7099 -25.0519 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.4136 -24.6406 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.0211 -25.4237 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
36.7536 -23.8047 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.2878 -23.4185 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.0555 -23.0052 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
34.0579 -24.4002 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
28.2870 -22.6013 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
27.5805 -23.8278 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
27.5740 -23.0093 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
1 4 1 0
2 3 1 0
3 6 1 0
5 4 1 0
5 6 1 0
5 8 1 0
6 10 1 0
9 7 1 0
7 8 1 0
9 10 1 0
10 11 1 0
11 12 1 0
12 13 1 0
9 13 1 0
5 14 1 1
3 15 1 1
2 16 1 0
16 17 1 0
17 18 1 0
17 19 2 0
18 20 2 0
20 21 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 18 1 0
12 25 2 0
13 26 2 0
21 27 1 0
9 28 1 6
10 29 1 1
27 30 1 0
27 31 1 0
27 32 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 422.44Molecular Weight (Monoisotopic): 422.1705AlogP: 5.17#Rotatable Bonds: 2Polar Surface Area: 52.60Molecular Species: ┄HBA: 4HBD: ┄#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): ┄#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 5.85CX LogD: 5.85Aromatic Rings: 1Heavy Atoms: 30QED Weighted: 0.49Np Likeness Score: 1.50
References 1. Chen H, Wu G, Gao S, Guo R, Zhao Z, Yuan H, Liu S, Wu J, Lu X, Yuan X, Yu Z, Zu X, Xie N, Yang N, Hu Z, Sun Q, Zhang W.. (2017) Discovery of Potent Small-Molecule Inhibitors of Ubiquitin-Conjugating Enzyme UbcH5c from α-Santonin Derivatives., 60 (16): [PMID:28696694 ] [10.1021/acs.jmedchem.6b01829 ]