2-(2,4-difluorophenyl)-1,1-difluoro-3-(1H-tetrazol-1-yl)-1-(5-((4-(2,2,2-trifluoroethylamino)phenyl)ethynyl)pyridin-2-yl)propan-2-ol

ID: ALA4096118

PubChem CID: 89619588

Max Phase: Preclinical

Molecular Formula: C25H17F7N6O

Molecular Weight: 550.44

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  OC(Cn1cnnn1)(c1ccc(F)cc1F)C(F)(F)c1ccc(C#Cc2ccc(NCC(F)(F)F)cc2)cn1

Standard InChI:  InChI=1S/C25H17F7N6O/c26-18-6-9-20(21(27)11-18)23(39,14-38-15-35-36-37-38)25(31,32)22-10-5-17(12-33-22)2-1-16-3-7-19(8-4-16)34-13-24(28,29)30/h3-12,15,34,39H,13-14H2

Standard InChI Key:  VDNSLSLDVQPTPX-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 39 42  0  0  0  0  0  0  0  0999 V2000
   21.7299  -10.3387    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   21.7340  -11.1559    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.4396  -10.7437    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   21.0241  -11.5727    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.3123  -11.1600    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.0241  -12.3941    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.4478  -11.5727    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.3100  -12.8008    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.3096  -13.6214    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.0220  -14.0349    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.7362  -13.6178    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.7330  -12.7986    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.3123  -10.3387    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   20.9755   -9.8557    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   20.7230   -9.0744    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   19.9016   -9.0744    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   19.6451   -9.8557    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.0200  -10.7514    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   22.4452  -12.3951    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   23.1562  -12.8037    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.8649  -12.3950    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.8623  -11.5695    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.1549  -11.1605    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.5760  -12.7966    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.2883  -13.2084    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.0007  -13.6161    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.9999  -14.4381    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.7114  -14.8498    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.4237  -14.4361    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.4200  -13.6106    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.7079  -13.2067    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.6035  -12.3900    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   21.0231  -14.8521    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   28.1328  -14.8422    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   28.1358  -15.6594    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.8449  -16.0654    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.8478  -16.8826    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   29.5512  -15.6543    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   29.5468  -16.4718    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  1  0
  4  2  1  0
  4  5  1  0
  4  6  1  0
  2  7  1  0
  6  8  2  0
  8  9  1  0
  9 10  2  0
 10 11  1  0
 11 12  2  0
 12  6  1  0
  5 13  1  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17 13  1  0
  4 18  1  0
  7 19  2  0
 19 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23  7  1  0
 24 25  3  0
 21 24  1  0
 25 26  1  0
 26 27  2  0
 27 28  1  0
 28 29  2  0
 29 30  1  0
 30 31  2  0
 31 26  1  0
  8 32  1  0
 10 33  1  0
 29 34  1  0
 34 35  1  0
 35 36  1  0
 36 37  1  0
 36 38  1  0
 36 39  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4096118

    CID 89619588

Associated Targets(Human)

CYP3A4 Tclin Cytochrome P450 3A4 (53859 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

ERG11 Cytochrome P450 51 (617 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Lanosterol 14-alpha demethylase (57 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 550.44Molecular Weight (Monoisotopic): 550.1352AlogP: 4.40#Rotatable Bonds: 7
Polar Surface Area: 88.75Molecular Species: NEUTRALHBA: 7HBD: 2
#RO5 Violations: 1HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski): 1
CX Acidic pKa: 10.66CX Basic pKa: 1.45CX LogP: 4.80CX LogD: 4.80
Aromatic Rings: 4Heavy Atoms: 39QED Weighted: 0.26Np Likeness Score: -1.62

References

1. Yates CM, Garvey EP, Shaver SR, Schotzinger RJ, Hoekstra WJ..  (2017)  Design and optimization of highly-selective, broad spectrum fungal CYP51 inhibitors.,  27  (15): [PMID:28651982] [10.1016/j.bmcl.2017.06.037]

Source