The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-(2,4-difluorophenyl)-1,1-difluoro-3-(1H-tetrazol-1-yl)-1-(5-((4-(2,2,2-trifluoroethylamino)phenyl)ethynyl)pyridin-2-yl)propan-2-ol ID: ALA4096118
PubChem CID: 89619588
Max Phase: Preclinical
Molecular Formula: C25H17F7N6O
Molecular Weight: 550.44
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: OC(Cn1cnnn1)(c1ccc(F)cc1F)C(F)(F)c1ccc(C#Cc2ccc(NCC(F)(F)F)cc2)cn1
Standard InChI: InChI=1S/C25H17F7N6O/c26-18-6-9-20(21(27)11-18)23(39,14-38-15-35-36-37-38)25(31,32)22-10-5-17(12-33-22)2-1-16-3-7-19(8-4-16)34-13-24(28,29)30/h3-12,15,34,39H,13-14H2
Standard InChI Key: VDNSLSLDVQPTPX-UHFFFAOYSA-N
Molfile:
RDKit 2D
39 42 0 0 0 0 0 0 0 0999 V2000
21.7299 -10.3387 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
21.7340 -11.1559 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.4396 -10.7437 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
21.0241 -11.5727 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.3123 -11.1600 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.0241 -12.3941 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.4478 -11.5727 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.3100 -12.8008 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.3096 -13.6214 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.0220 -14.0349 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.7362 -13.6178 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.7330 -12.7986 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.3123 -10.3387 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
20.9755 -9.8557 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
20.7230 -9.0744 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.9016 -9.0744 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.6451 -9.8557 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.0200 -10.7514 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
22.4452 -12.3951 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
23.1562 -12.8037 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.8649 -12.3950 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.8623 -11.5695 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.1549 -11.1605 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.5760 -12.7966 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.2883 -13.2084 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.0007 -13.6161 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.9999 -14.4381 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.7114 -14.8498 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.4237 -14.4361 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.4200 -13.6106 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.7079 -13.2067 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.6035 -12.3900 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
21.0231 -14.8521 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
28.1328 -14.8422 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
28.1358 -15.6594 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.8449 -16.0654 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.8478 -16.8826 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
29.5512 -15.6543 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
29.5468 -16.4718 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 2 1 0
4 2 1 0
4 5 1 0
4 6 1 0
2 7 1 0
6 8 2 0
8 9 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 6 1 0
5 13 1 0
13 14 1 0
14 15 2 0
15 16 1 0
16 17 2 0
17 13 1 0
4 18 1 0
7 19 2 0
19 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 7 1 0
24 25 3 0
21 24 1 0
25 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 26 1 0
8 32 1 0
10 33 1 0
29 34 1 0
34 35 1 0
35 36 1 0
36 37 1 0
36 38 1 0
36 39 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 550.44Molecular Weight (Monoisotopic): 550.1352AlogP: 4.40#Rotatable Bonds: 7Polar Surface Area: 88.75Molecular Species: NEUTRALHBA: 7HBD: 2#RO5 Violations: 1HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: 10.66CX Basic pKa: 1.45CX LogP: 4.80CX LogD: 4.80Aromatic Rings: 4Heavy Atoms: 39QED Weighted: 0.26Np Likeness Score: -1.62
References 1. Yates CM, Garvey EP, Shaver SR, Schotzinger RJ, Hoekstra WJ.. (2017) Design and optimization of highly-selective, broad spectrum fungal CYP51 inhibitors., 27 (15): [PMID:28651982 ] [10.1016/j.bmcl.2017.06.037 ]