The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
1-acetyl-N-hydroxy-4-(4-((2-methyl-5,6,7,8-tetrahydroquinolin-4-yl)methoxy)phenylsulfonyl)piperazine-2-carboxamide ID: ALA4096228
PubChem CID: 137655494
Max Phase: Preclinical
Molecular Formula: C24H30N4O6S
Molecular Weight: 502.59
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CC(=O)N1CCN(S(=O)(=O)c2ccc(OCc3cc(C)nc4c3CCCC4)cc2)CC1C(=O)NO
Standard InChI: InChI=1S/C24H30N4O6S/c1-16-13-18(21-5-3-4-6-22(21)25-16)15-34-19-7-9-20(10-8-19)35(32,33)27-11-12-28(17(2)29)23(14-27)24(30)26-31/h7-10,13,23,31H,3-6,11-12,14-15H2,1-2H3,(H,26,30)
Standard InChI Key: HYDKSBMYJRLINH-UHFFFAOYSA-N
Molfile:
RDKit 2D
35 38 0 0 0 0 0 0 0 0999 V2000
27.6712 -1.5584 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
28.0879 -2.2751 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
28.5003 -1.5558 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
25.9504 -2.6876 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.9504 -3.5126 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
26.6625 -3.9209 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.3744 -3.5126 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.3744 -2.6876 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
26.6625 -2.2708 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.2365 -3.9261 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.5215 -3.5146 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.2378 -4.7511 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
28.8034 -2.6917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.7987 -3.5208 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.5133 -3.9373 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.2329 -3.5260 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.2334 -2.6937 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.5181 -2.2809 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.9464 -3.9403 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
30.9444 -4.7653 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.6578 -5.1795 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.6540 -6.0053 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.3666 -6.4195 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.0831 -6.0087 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
32.3693 -4.7690 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.0808 -5.1820 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.7903 -4.7746 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.7945 -3.9525 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.0829 -3.5395 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.3672 -3.9485 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.3642 -7.2445 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.2347 -2.2771 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.2323 -1.4522 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
24.5215 -2.6917 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
23.8058 -2.2813 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
4 5 1 0
4 9 1 0
5 6 1 0
6 7 1 0
7 8 1 0
8 9 1 0
5 10 1 0
10 11 1 0
10 12 2 0
8 2 1 0
2 13 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 13 1 0
16 19 1 0
19 20 1 0
20 21 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 26 1 0
25 21 1 0
25 26 2 0
25 30 1 0
26 27 1 0
27 28 1 0
28 29 1 0
29 30 1 0
23 31 1 0
4 32 1 0
32 33 2 0
32 34 1 0
34 35 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 502.59Molecular Weight (Monoisotopic): 502.1886AlogP: 1.57#Rotatable Bonds: 6Polar Surface Area: 129.14Molecular Species: NEUTRALHBA: 7HBD: 2#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: 8.71CX Basic pKa: 6.55CX LogP: 0.79CX LogD: 0.71Aromatic Rings: 2Heavy Atoms: 35QED Weighted: 0.45Np Likeness Score: -1.29
References 1. Ouvry G, Berton Y, Bhurruth-Alcor Y, Bonnary L, Bouix-Peter C, Bouquet K, Bourotte M, Chambon S, Comino C, Deprez B, Duvert D, Duvert G, Hacini-Rachinel F, Harris CS, Luzy AP, Mathieu A, Millois C, Pascau J, Pinto A, Polge G, Reitz A, Reversé K, Rosignoli C, Taquet N, Hennequin LF.. (2017) Identification of novel TACE inhibitors compatible with topical application., 27 (8): [PMID:28274635 ] [10.1016/j.bmcl.2017.02.035 ]