(S)-4-benzyl-1-(4-((S)-2-(cyclohexylmethyl)-4,5-dihydro-1H-imidazol-4-yl)butyl)-3-phenethylimidazolidine-2-thione

ID: ALA4096280

PubChem CID: 137655509

Max Phase: Preclinical

Molecular Formula: C32H44N4S

Molecular Weight: 516.80

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  S=C1N(CCCC[C@H]2CNC(CC3CCCCC3)=N2)C[C@H](Cc2ccccc2)N1CCc1ccccc1

Standard InChI:  InChI=1S/C32H44N4S/c37-32-35(20-11-10-18-29-24-33-31(34-29)23-28-16-8-3-9-17-28)25-30(22-27-14-6-2-7-15-27)36(32)21-19-26-12-4-1-5-13-26/h1-2,4-7,12-15,28-30H,3,8-11,16-25H2,(H,33,34)/t29-,30-/m0/s1

Standard InChI Key:  AQHCGEKXMXOGSR-KYJUHHDHSA-N

Molfile:  

     RDKit          2D

 37 41  0  0  0  0  0  0  0  0999 V2000
    6.3007   -3.4289    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9551   -3.9183    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.6240   -3.4486    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3818   -2.6654    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5655   -2.6570    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.5197   -3.6696    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9208   -3.1137    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1016   -2.3132    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5066   -1.7583    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7241   -1.9951    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5400   -2.7923    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1384   -3.3526    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3972   -3.7129    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5550   -4.5147    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3283   -4.7790    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4860   -5.5808    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.2593   -5.8451    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.4986   -6.6256    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.3157   -6.6380    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.5800   -5.8647    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.9262   -5.3745    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9380   -4.5574    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   11.7860   -7.3063    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.3808   -8.0163    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.5666   -8.0162    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1616   -8.7251    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.5738   -9.4317    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.3952   -9.4250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.7965   -8.7155    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.3610   -5.6239    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.9599   -6.1798    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.7408   -5.9390    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.3380   -6.4955    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.1183   -6.2553    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.3009   -5.4579    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.6970   -4.9010    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.9191   -5.1442    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  1  1  0
  1  6  1  0
  6  7  1  0
  7  8  1  0
  7 12  1  0
  8  9  1  0
  9 10  1  0
 10 11  1  0
 11 12  1  0
  3 13  1  6
 13 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 21 17  1  0
 21 22  2  0
 19 23  1  1
 23 24  1  0
 24 25  2  0
 25 26  1  0
 26 27  2  0
 27 28  1  0
 28 29  2  0
 29 24  1  0
 20 30  1  0
 30 31  1  0
 31 32  1  0
 32 33  2  0
 33 34  1  0
 34 35  2  0
 35 36  1  0
 36 37  2  0
 37 32  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4096280

    ---

Associated Targets(Human)

RORA Tchem Nuclear receptor ROR-alpha (562 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

Rorb Nuclear receptor ROR-beta (15 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Rorc Nuclear receptor ROR-gamma (89407 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 516.80Molecular Weight (Monoisotopic): 516.3287AlogP: 6.25#Rotatable Bonds: 12
Polar Surface Area: 30.87Molecular Species: BASEHBA: 3HBD: 1
#RO5 Violations: 2HBA (Lipinski): 4HBD (Lipinski): 1#RO5 Violations (Lipinski): 2
CX Acidic pKa: CX Basic pKa: 10.39CX LogP: 6.92CX LogD: 4.60
Aromatic Rings: 2Heavy Atoms: 37QED Weighted: 0.27Np Likeness Score: -0.21

References

1. Nefzi A, Marconi GD, Ortiz MA, Davis JC, Piedrafita FJ..  (2017)  Synthesis of dihydroimidazole tethered imidazolinethiones and their activity as novel antagonists of the nuclear retinoic acid receptor-related orphan receptors (RORs).,  27  (7): [PMID:28242276] [10.1016/j.bmcl.2017.02.014]

Source