2-(2-Methyl-5-nitro-1H-imidazol-1-yl)ethyl 2,5-dichlorobenzoate

ID: ALA4096282

PubChem CID: 137655722

Max Phase: Preclinical

Molecular Formula: C13H11Cl2N3O4

Molecular Weight: 344.15

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Cc1ncc([N+](=O)[O-])n1CCOC(=O)c1cc(Cl)ccc1Cl

Standard InChI:  InChI=1S/C13H11Cl2N3O4/c1-8-16-7-12(18(20)21)17(8)4-5-22-13(19)10-6-9(14)2-3-11(10)15/h2-3,6-7H,4-5H2,1H3

Standard InChI Key:  IJUJQMQYCJSJJF-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 22 23  0  0  0  0  0  0  0  0999 V2000
   27.3996  -18.7584    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   28.0540  -18.2690    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.7927  -17.4947    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.9730  -17.5055    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   26.7341  -18.2861    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.4097  -19.5755    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.8364  -18.5116    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   29.4368  -17.9572    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   29.0163  -19.3088    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   28.1224  -19.9753    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.1325  -20.7924    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   28.8452  -21.1922    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.8554  -22.0093    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.5478  -20.7749    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   25.9606  -18.5496    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.1520  -22.4217    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.1618  -23.2381    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.8751  -23.6387    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.5799  -23.2169    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.5667  -22.4020    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.4405  -22.0197    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   30.2941  -23.6142    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  3  4  1  0
  4  5  2  0
  5  1  1  0
  1  6  1  0
  7  8  2  0
  7  9  1  0
  2  7  1  0
  6 10  1  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
 12 14  2  0
  5 15  1  0
 13 16  2  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 13  1  0
 16 21  1  0
 19 22  1  0
M  CHG  2   7   1   9  -1
M  END

Alternative Forms

  1. Parent:

    ALA4096282

    ---

Associated Targets(non-human)

GUSB Beta-glucuronidase (291 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 344.15Molecular Weight (Monoisotopic): 343.0127AlogP: 3.26#Rotatable Bonds: 5
Polar Surface Area: 87.26Molecular Species: NEUTRALHBA: 6HBD:
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 3.27CX LogP: 3.24CX LogD: 3.24
Aromatic Rings: 2Heavy Atoms: 22QED Weighted: 0.47Np Likeness Score: -1.99

References

1. Salar U, Khan KM, Taha M, Ismail NH, Ali B, Qurat-Ul-Ain, Perveen S, Ghufran M, Wadood A..  (2017)  Biology-oriented drug synthesis (BIODS): In vitro β-glucuronidase inhibitory and in silico studies on 2-(2-methyl-5-nitro-1H-imidazol-1-yl)ethyl aryl carboxylate derivatives.,  125  [PMID:27886546] [10.1016/j.ejmech.2016.11.031]

Source