The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-n-Hexylphenyl alpha-D-glucopyranoside-6-sulfate ID: ALA4096324
PubChem CID: 137655730
Max Phase: Preclinical
Molecular Formula: C18H28O9S
Molecular Weight: 420.48
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCCCCCc1ccc(O[C@H]2O[C@H](COS(=O)(=O)O)[C@@H](O)[C@H](O)[C@H]2O)cc1
Standard InChI: InChI=1S/C18H28O9S/c1-2-3-4-5-6-12-7-9-13(10-8-12)26-18-17(21)16(20)15(19)14(27-18)11-25-28(22,23)24/h7-10,14-21H,2-6,11H2,1H3,(H,22,23,24)/t14-,15-,16+,17-,18+/m1/s1
Standard InChI Key: PFVWZOZQBSGDKK-SFFUCWETSA-N
Molfile:
RDKit 2D
28 29 0 0 0 0 0 0 0 0999 V2000
16.4140 -8.8529 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.0095 -9.5628 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
16.8265 -9.5581 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.0136 -12.0185 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.0136 -12.8357 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.7189 -13.2401 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.4242 -12.8357 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.4242 -12.0185 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.7189 -11.6058 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.7189 -10.7886 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.0112 -10.3800 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.7189 -14.0573 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.3065 -13.2453 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.3047 -11.6120 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.1313 -13.2453 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.8396 -12.8377 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.5451 -13.2482 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.2529 -12.8413 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.2545 -12.0233 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.5424 -11.6138 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.8375 -12.0231 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.3035 -9.1542 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
20.9623 -11.6148 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.6700 -12.0235 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.3777 -11.6149 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.0854 -12.0236 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.7931 -11.6151 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.5008 -12.0238 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
4 5 1 0
4 9 1 0
5 6 1 0
6 7 1 0
7 8 1 0
8 9 1 0
9 10 1 1
10 11 1 0
6 12 1 6
5 13 1 1
4 14 1 6
7 15 1 6
15 16 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 16 1 0
11 2 1 0
2 22 1 0
19 23 1 0
23 24 1 0
24 25 1 0
25 26 1 0
26 27 1 0
27 28 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 420.48Molecular Weight (Monoisotopic): 420.1454AlogP: 0.82#Rotatable Bonds: 10Polar Surface Area: 142.75Molecular Species: ACIDHBA: 8HBD: 4#RO5 Violations: ┄HBA (Lipinski): 9HBD (Lipinski): 4#RO5 Violations (Lipinski): ┄CX Acidic pKa: -1.96CX Basic pKa: ┄CX LogP: 0.37CX LogD: -0.18Aromatic Rings: 1Heavy Atoms: 28QED Weighted: 0.32Np Likeness Score: 1.48
References 1. Liu C, Dunaway-Mariano D, Mariano PS.. (2017) Rational design of reversible inhibitors for trehalose 6-phosphate phosphatases., 128 [PMID:28192710 ] [10.1016/j.ejmech.2017.02.001 ]