3-chloro-N-(2,4-difluoro-3-((3-methoxy-1H-pyrazolo[3,4-b]pyridin-5-yl)ethynyl)phenyl)benzenesulfonamide

ID: ALA4096439

PubChem CID: 137655959

Max Phase: Preclinical

Molecular Formula: C21H13ClF2N4O3S

Molecular Weight: 474.88

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COc1n[nH]c2ncc(C#Cc3c(F)ccc(NS(=O)(=O)c4cccc(Cl)c4)c3F)cc12

Standard InChI:  InChI=1S/C21H13ClF2N4O3S/c1-31-21-16-9-12(11-25-20(16)26-27-21)5-6-15-17(23)7-8-18(19(15)24)28-32(29,30)14-4-2-3-13(22)10-14/h2-4,7-11,28H,1H3,(H,25,26,27)

Standard InChI Key:  NEDXWYOBFJNWEA-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 32 35  0  0  0  0  0  0  0  0999 V2000
   23.8237   -4.5789    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   23.4154   -3.8665    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   23.0026   -4.5763    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   20.5600   -3.8789    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.5588   -4.7062    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.2736   -5.1191    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.9900   -4.7058    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.9872   -3.8753    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.2718   -3.4662    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.7001   -3.4602    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   24.1289   -3.4547    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.2693   -2.6413    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   19.8441   -5.1182    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   19.8454   -3.4666    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.1275   -3.0525    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.4129   -2.6404    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.4167   -1.8173    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.7029   -1.4051    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   17.7051   -3.0556    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.9907   -2.6472    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.9908   -1.8146    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.1990   -1.5572    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   15.7095   -2.2308    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   16.1989   -2.9043    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.9439   -3.6889    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.1369   -3.8603    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.8432   -3.8679    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.5556   -3.4535    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.5530   -2.6276    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.8320   -2.2181    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.1226   -2.6349    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.8260   -1.3931    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  2  0
  4  5  2  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  2  0
  9  4  1  0
  8 10  1  0
 10  2  1  0
  2 11  1  0
  9 12  1  0
  5 13  1  0
  4 14  1  0
 14 15  3  0
 15 16  1  0
 16 17  2  0
 17 18  1  0
 18 21  2  0
 20 19  2  0
 19 16  1  0
 20 21  1  0
 21 22  1  0
 22 23  1  0
 23 24  2  0
 24 20  1  0
 24 25  1  0
 25 26  1  0
 11 27  2  0
 27 28  1  0
 28 29  2  0
 29 30  1  0
 30 31  2  0
 31 11  1  0
 30 32  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4096439

    ---

Associated Targets(Human)

MAP3K20 Tchem Mixed lineage kinase 7 (1473 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
BRAF Tclin Serine/threonine-protein kinase B-raf (11587 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 474.88Molecular Weight (Monoisotopic): 474.0365AlogP: 4.10#Rotatable Bonds: 4
Polar Surface Area: 96.97Molecular Species: NEUTRALHBA: 5HBD: 2
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 8.38CX Basic pKa: 0.84CX LogP: 4.38CX LogD: 4.34
Aromatic Rings: 4Heavy Atoms: 32QED Weighted: 0.43Np Likeness Score: -2.00

References

1. Chang Y, Lu X, Shibu MA, Dai YB, Luo J, Zhang Y, Li Y, Zhao P, Zhang Z, Xu Y, Tu ZC, Zhang QW, Yun CH, Huang CY, Ding K..  (2017)  Structure Based Design of N-(3-((1H-Pyrazolo[3,4-b]pyridin-5-yl)ethynyl)benzenesulfonamides as Selective Leucine-Zipper and Sterile-α Motif Kinase (ZAK) Inhibitors.,  60  (13): [PMID:28586211] [10.1021/acs.jmedchem.7b00572]
2. Yang J, Shibu MA, Kong L, Luo J, BadrealamKhan F, Huang Y, Tu ZC, Yun CH, Huang CY, Ding K, Lu X..  (2020)  Design, Synthesis, and Structure-Activity Relationships of 1,2,3-Triazole Benzenesulfonamides as New Selective Leucine-Zipper and Sterile-α Motif Kinase (ZAK) Inhibitors.,  63  (5): [PMID:31244114] [10.1021/acs.jmedchem.9b00664]

Source