The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(S)-5-amino-4-((S)-4-carboxy-2-((R)-2-((3-(3'-chlorobiphenyl-4-yl)isoxazol-5-yl)methyl)-4-(hydroxyamino)-4-oxobutanamido)butanamido)-5-oxopentanoic acid ID: ALA4096462
PubChem CID: 121493953
Max Phase: Preclinical
Molecular Formula: C30H32ClN5O10
Molecular Weight: 658.06
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: NC(=O)[C@H](CCC(=O)O)NC(=O)[C@H](CCC(=O)O)NC(=O)[C@@H](CC(=O)NO)Cc1cc(-c2ccc(-c3cccc(Cl)c3)cc2)no1
Standard InChI: InChI=1S/C30H32ClN5O10/c31-20-3-1-2-18(12-20)16-4-6-17(7-5-16)24-15-21(46-36-24)13-19(14-25(37)35-45)29(43)34-23(9-11-27(40)41)30(44)33-22(28(32)42)8-10-26(38)39/h1-7,12,15,19,22-23,45H,8-11,13-14H2,(H2,32,42)(H,33,44)(H,34,43)(H,35,37)(H,38,39)(H,40,41)/t19-,22+,23+/m1/s1
Standard InChI Key: VBMQORMYXJZHKU-OIBXWCBGSA-N
Molfile:
RDKit 2D
46 48 0 0 0 0 0 0 0 0999 V2000
19.6179 -4.9479 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.6138 -5.7765 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.8970 -6.1826 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.8898 -7.0098 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.6021 -7.4245 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.5949 -8.2517 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.3114 -8.6665 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.8822 -8.6579 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.1816 -5.7624 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.4688 -6.1727 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.7524 -5.7578 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.7524 -4.9325 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.4688 -4.5177 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.4688 -3.6964 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.1874 -3.2816 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.7524 -3.2816 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.0343 -6.1760 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.3163 -5.7578 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.5998 -6.1727 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.6039 -7.0011 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.8916 -7.4160 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.8291 -8.2360 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0064 -8.3954 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.5887 -9.1135 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9659 -9.8311 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.5239 -10.5288 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6998 -10.5125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2865 -11.1962 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6622 -11.9290 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2447 -12.6124 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6473 -13.3655 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
10.4197 -12.6157 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0312 -11.9022 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4623 -11.1934 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.3157 -9.7539 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7442 -9.0774 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.5980 -7.6789 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.1621 -7.0858 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.8871 -5.7624 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.3163 -4.9324 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.4606 -7.0011 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
20.3262 -6.1912 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.8861 -4.9374 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.6006 -4.5249 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.1714 -4.5253 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.1709 -3.7003 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 1 6
4 5 1 0
5 6 1 0
6 7 1 0
6 8 2 0
3 9 1 0
9 10 1 0
10 11 1 0
11 12 1 0
12 13 1 0
13 14 1 0
14 15 1 0
14 16 2 0
11 17 1 1
17 18 1 0
18 19 1 0
19 20 1 6
20 21 1 0
21 22 2 0
22 23 1 0
23 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 30 1 0
30 31 1 0
30 32 2 0
32 33 1 0
33 34 2 0
28 34 1 0
27 35 1 0
35 36 2 0
24 36 1 0
23 37 2 0
37 38 1 0
21 38 1 0
19 39 1 0
18 40 2 0
10 41 2 0
2 42 2 0
39 43 1 0
43 44 2 0
43 45 1 0
45 46 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 658.06Molecular Weight (Monoisotopic): 657.1838AlogP: 1.90#Rotatable Bonds: 17Polar Surface Area: 251.25Molecular Species: ACIDHBA: 9HBD: 7#RO5 Violations: 2HBA (Lipinski): 15HBD (Lipinski): 8#RO5 Violations (Lipinski): 3CX Acidic pKa: 3.91CX Basic pKa: ┄CX LogP: 0.74CX LogD: -5.27Aromatic Rings: 3Heavy Atoms: 46QED Weighted: 0.08Np Likeness Score: -0.47
References 1. Rouanet-Mehouas C, Czarny B, Beau F, Cassar-Lajeunesse E, Stura EA, Dive V, Devel L.. (2017) Zinc-Metalloproteinase Inhibitors: Evaluation of the Complex Role Played by the Zinc-Binding Group on Potency and Selectivity., 60 (1): [PMID:27996256 ] [10.1021/acs.jmedchem.6b01420 ]