The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
7(E)-(3-Cyanobenzylidene)naltrexone ID: ALA4096636
PubChem CID: 137654581
Max Phase: Preclinical
Molecular Formula: C28H26N2O4
Molecular Weight: 454.53
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: N#Cc1cccc(/C=C2\C[C@@]3(O)[C@H]4Cc5ccc(O)c6c5[C@@]3(CCN4CC3CC3)[C@@H](O6)C2=O)c1
Standard InChI: InChI=1S/C28H26N2O4/c29-14-18-3-1-2-17(10-18)11-20-13-28(33)22-12-19-6-7-21(31)25-23(19)27(28,26(34-25)24(20)32)8-9-30(22)15-16-4-5-16/h1-3,6-7,10-11,16,22,26,31,33H,4-5,8-9,12-13,15H2/b20-11+/t22-,26+,27+,28-/m1/s1
Standard InChI Key: OJLDPMNDSAPRSY-RLEPZMFISA-N
Molfile:
RDKit 2D
36 42 0 0 0 0 0 0 0 0999 V2000
5.4025 -4.7298 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8111 -4.0240 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5854 -4.7298 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7988 -5.4232 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1891 -5.4232 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9568 -5.9143 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.3778 -3.3183 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4025 -2.5011 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.1891 -4.0240 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5854 -3.3183 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9816 -4.0240 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6283 -4.0240 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6159 -5.4356 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8111 -1.7788 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3719 -5.4232 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9816 -3.0211 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6283 -1.7706 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3423 -2.1668 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3341 -1.3496 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3719 -4.0240 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0369 -4.7298 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2197 -3.3059 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.0245 -6.1537 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.9592 -4.7298 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9510 -6.1496 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.0918 -2.9097 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
5.7988 -6.3394 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
7.8541 -4.7351 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2673 -4.0301 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0836 -4.0386 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4967 -3.3344 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0927 -2.6231 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2713 -2.6204 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8619 -3.3252 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3094 -3.3433 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1266 -3.3490 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 1 1 0
4 1 1 0
5 3 2 0
6 4 1 0
7 2 1 0
8 16 1 0
9 3 1 0
10 9 1 0
1 11 1 1
12 2 1 0
13 4 1 0
14 8 1 0
15 5 1 0
16 11 1 0
17 14 1 0
18 17 1 0
19 17 1 0
20 9 2 0
21 13 1 0
2 22 1 1
23 13 2 0
24 20 1 0
25 15 1 0
7 26 1 6
4 27 1 1
5 6 1 0
8 7 1 0
21 12 1 0
10 7 1 0
24 15 2 0
18 19 1 0
21 28 2 0
28 29 1 0
29 30 2 0
30 31 1 0
31 32 2 0
32 33 1 0
33 34 2 0
34 29 1 0
35 36 3 0
31 35 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 454.53Molecular Weight (Monoisotopic): 454.1893AlogP: 3.09#Rotatable Bonds: 3Polar Surface Area: 93.79Molecular Species: BASEHBA: 6HBD: 2#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 10.11CX Basic pKa: 8.90CX LogP: 3.27CX LogD: 2.02Aromatic Rings: 2Heavy Atoms: 34QED Weighted: 0.69Np Likeness Score: 0.67
References 1. Kutsumura N, Koyama Y, Nagumo Y, Nakajima R, Miyata Y, Yamamoto N, Saitoh T, Yoshida N, Iwata S, Nagase H.. (2017) Antitrichomonal activity of δ opioid receptor antagonists, 7-benzylidenenaltrexone derivatives., 25 (16): [PMID:28662966 ] [10.1016/j.bmc.2017.06.026 ]